CAS 23413-66-3
:1-chloro-2-[(methylsulfinyl)methyl]benzene
Description:
1-Chloro-2-[(methylsulfinyl)methyl]benzene, with the CAS number 23413-66-3, is an organic compound characterized by the presence of a chlorobenzene ring substituted with a methylsulfinyl group. This compound features a chlorine atom attached to the second carbon of the benzene ring and a methylsulfinyl group (-S(=O)-CH3) at the para position relative to the chlorine. The presence of the sulfinyl group imparts unique chemical properties, including potential reactivity in nucleophilic substitution reactions. The compound is likely to exhibit moderate polarity due to the electronegative chlorine and sulfur atoms, influencing its solubility in various solvents. Additionally, the structure suggests potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 1-chloro-2-[(methylsulfinyl)methyl]benzene is a versatile compound with interesting chemical behavior due to its functional groups.
Formula:C8H9ClOS
InChI:InChI=1/C8H9ClOS/c1-11(10)6-7-4-2-3-5-8(7)9/h2-5H,6H2,1H3
SMILES:CS(=O)Cc1ccccc1Cl
Synonyms:- 2-Chlorobenzyl methyl sulfoxide
- Benzene, 1-Chloro-2-[(Methylsulfinyl)Methyl]-
- 1-Chloro-2-[(methylsulfinyl)methyl]benzene
- 1-Chloro-2-((methylsulfinyl)methyl)benzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
o-Chlorobenzyl Methyl Sulfoxide
CAS:Controlled ProductFormula:C8H9ClOSColor and Shape:NeatMolecular weight:188.674o-Chlorobenzyl methyl sulfoxide
CAS:o-Chlorobenzyl methyl sulfoxide is a potent inhibitor of kinases, which are enzymes that play a crucial role in cell signaling and regulation. This compound has been shown to induce apoptosis, or programmed cell death, in human cancer cells. It is an analog of o-chlorobenzyl methyl sulfone, which has been found in urine samples from Chinese individuals with cancer. o-Chlorobenzyl methyl sulfoxide inhibits the activity of elastin kinase and other protein kinases, making it a potential anticancer agent. Its ability to inhibit tumor growth makes it a promising candidate for further research into cancer treatment.Formula:C8H9ClOSPurity:Min. 95%Molecular weight:188.67 g/mol


