CAS 23419-43-4
:4-phenyl-2-[2-(pyrrolidin-1-yl)ethyl]-6-[3-(trifluoromethyl)phenyl]pyridazin-3(2H)-one
Description:
4-Phenyl-2-[2-(pyrrolidin-1-yl)ethyl]-6-[3-(trifluoromethyl)phenyl]pyridazin-3(2H)-one is a synthetic organic compound characterized by its complex structure, which includes a pyridazine core substituted with various functional groups. The presence of a phenyl group and a trifluoromethyl group contributes to its lipophilicity and potential biological activity. The pyrrolidine moiety suggests possible interactions with biological targets, making it of interest in medicinal chemistry. This compound may exhibit properties such as analgesic, anti-inflammatory, or neuroprotective effects, although specific biological activities would depend on empirical studies. Its molecular structure indicates potential for hydrogen bonding and π-π stacking interactions, which could influence its solubility and reactivity. The trifluoromethyl group is known to enhance metabolic stability and lipophilicity, potentially affecting the pharmacokinetics of the compound. Overall, 4-phenyl-2-[2-(pyrrolidin-1-yl)ethyl]-6-[3-(trifluoromethyl)phenyl]pyridazin-3(2H)-one represents a class of compounds that may have significant implications in drug development and therapeutic applications.
Formula:C23H22F3N3O
InChI:InChI=1/C23H22F3N3O/c24-23(25,26)19-10-6-9-18(15-19)21-16-20(17-7-2-1-3-8-17)22(30)29(27-21)14-13-28-11-4-5-12-28/h1-3,6-10,15-16H,4-5,11-14H2
SMILES:c1ccc(cc1)c1cc(c2cccc(c2)C(F)(F)F)nn(CCN2CCCC2)c1=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
4-Phenyl-2-(2-(pyrrolidin-1-yl)ethyl)-6-(3-(trifluoromethyl)phenyl)pyridazin-3(2H)-one
CAS:Formula:C23H22F3N3OMolecular weight:413.43554-Phenyl-2-[2-(1-pyrrolidinyl)ethyl]-6-[3-(trifluoromethyl)phenyl]-3(2H)-pyridazinone-d8
CAS:Controlled ProductFormula:C23D8H14F3N3OColor and Shape:NeatMolecular weight:421.4854-Phenyl-2-[2-(1-pyrrolidinyl)ethyl]-6-[3-(trifluoromethyl)phenyl]-3(2H)-pyridazinone
CAS:Controlled ProductFormula:C23H22F3N3OColor and Shape:NeatMolecular weight:413.435

