CAS 23429-05-2

5-Ethoxy-4-methyl-2-oxazolecarboxylic acid

Description:

5-Ethoxy-4-methyl-2-oxazolecarboxylic acid is a heterocyclic organic compound characterized by the presence of an oxazole ring, which is a five-membered ring containing both nitrogen and oxygen atoms. This compound features an ethoxy group and a methyl group, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid functional group. The oxazole ring structure can impart specific reactivity, making it useful in various chemical syntheses and applications, particularly in pharmaceuticals and agrochemicals. The compound may also exhibit biological activity, although specific biological properties would depend on further studies. As with many organic compounds, it is essential to handle it with care, considering potential hazards associated with its chemical structure. Proper storage and handling protocols should be followed to ensure safety and stability.

Formula: C₇H₉NO₄

InChI: InChI=1S/C7H9NO4/c1-3-11-7-4(2)8-5(12-7)6(9)10/h3H2,1-2H3,(H,9,10)

InChI key: InChIKey=BDXXPIZNQMLMBS-UHFFFAOYSA-N

SMILES: O(CC)C=1OC(C(O)=O)=NC1C

Synonyms:

• 2-(Hydroxycarbonyl)-4-methyl-5-ethoxyoxazole
• 2-Oxazolecarboxylic acid, 5-ethoxy-4-methyl-
• 5-Ethoxy-4-methyl-2-oxazolecarboxylic acid

Vitamin B6 Impurity 14

CAS: 23429-05-2

Formula: C₇H₉NO₄

Molecular weight: 171.15

Ref: 4Z-V-033015