CAS 23432-39-5

4-Hydroxy-6-methoxyquinoline

Description:

4-Hydroxy-6-methoxyquinoline, with the CAS number 23432-39-5, is an organic compound belonging to the quinoline family, characterized by a fused bicyclic structure containing a benzene ring and a pyridine ring. This compound features a hydroxyl group (-OH) at the 4-position and a methoxy group (-OCH3) at the 6-position of the quinoline ring, which contribute to its chemical reactivity and potential biological activity. It is typically a yellow to brown solid, exhibiting moderate solubility in organic solvents and limited solubility in water. The presence of the hydroxyl and methoxy groups can influence its hydrogen bonding capabilities and overall polarity. 4-Hydroxy-6-methoxyquinoline has garnered interest in various fields, including medicinal chemistry, due to its potential pharmacological properties, such as antimicrobial and antitumor activities. Its synthesis often involves the modification of quinoline derivatives, and it can be analyzed using techniques like NMR and mass spectrometry to confirm its structure and purity.

Formula: C₁₀H₉NO₂

InChI: InChI=1/C10H9NO2/c1-13-7-2-3-9-8(6-7)10(12)4-5-11-9/h2-6H,1H3,(H,11,12)

SMILES: COc1ccc2c(c1)c(=O)cc[nH]2

Synonyms:

• 6-Methoxy-4-hydroxyquinoline
• 6-methoxyquinolin-4(1H)-one

4-Quinolinol, 6-methoxy-

CAS: 23432-39-5

Formula: C₁₀H₉NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 175.1840

Ref: IN-DA002N88

6-Methoxy-4-hydroxyquinoline

CAS: 23432-39-5

6-Methoxy-4-hydroxyquinoline

Purity: 97%

Molecular weight: 175.18g/mol

Ref: 54-OR301003

6-Methoxy-4-hydroxyquinoline

CAS: 23432-39-5

Formula: C₁₀H₉NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 175.187

Ref: 10-F216850