CAS 23432-42-0

6-Nitro-4-quinolinol

Description:

6-Nitro-4-quinolinol is an organic compound characterized by its quinoline structure, which features a nitrogen atom within a bicyclic aromatic system. This compound is typically recognized for its nitro group (-NO2) at the 6-position and a hydroxyl group (-OH) at the 4-position of the quinoline ring. These functional groups contribute to its chemical reactivity and potential applications in various fields, including medicinal chemistry and materials science. The presence of the nitro group can enhance the compound's electron-withdrawing properties, influencing its acidity and reactivity in electrophilic substitution reactions. Additionally, the hydroxyl group can participate in hydrogen bonding, affecting solubility and interaction with biological targets. 6-Nitro-4-quinolinol may exhibit antimicrobial or antitumor activity, making it of interest in pharmaceutical research. Its physical properties, such as melting point and solubility, can vary based on the specific conditions and solvents used. Overall, this compound serves as a valuable building block in the synthesis of more complex chemical entities.

Formula: C₉H₆N₂O₃

InChI: InChI=1S/C9H6N2O3/c12-9-3-4-10-8-2-1-6(11(13)14)5-7(8)9/h1-5H,(H,10,12)

InChI key: InChIKey=MGCGVNRWZOHFTO-UHFFFAOYSA-N

SMILES: OC=1C2=C(C=CC(N(=O)=O)=C2)N=CC1

Synonyms:

• 4-Hydroxy-6-nitroquinoline
• 4-Quinolinol, 6-Nitro-
• 6-Nitro-4-hydroxyquinoline
• 6-Nitro-4-quinolinol
• 6-Nitroquinolin-4-ol
• NSC 78445

4-Quinolinol, 6-nitro-

CAS: 23432-42-0

Formula: C₉H₆N₂O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 190.1555

Ref: IN-DA002N86

4-Hydroxy-6-nitroquinoline

CAS: 23432-42-0

4-Hydroxy-6-nitroquinoline

Purity: 96%

Molecular weight: 190.16g/mol

Ref: 54-OR962452

6-nitro-1,4-dihydroquinolin-4-one

CAS: 23432-42-0

Purity: 97%

Molecular weight: 190.1580048

Ref: 10-F606012

4-Hydroxy-6-nitroquinoline

CAS: 23432-42-0

4-Hydroxy-6-nitroquinoline is an amide compound that has shown potential in interferon research. It is a solute with an acid reaction and is commonly spray-dried for ease of use. This compound can be synthesized through a pyrazole-based method and is often found in hydrocarbon mixtures. Its cyano and phenoxy groups make it suitable for applications in semisolid formulations, while its phosphite moiety allows it to be incorporated into matrix composites. 4-Hydroxy-6-nitroquinoline is commonly used in the field of Research Chemicals and has been studied for its interactions with uridine.

Formula: C₉H₆N₂O₃

Purity: Min. 95%

Molecular weight: 190.16 g/mol

Ref: 3D-YAA43242