
CAS 23432-46-4
:8-Nitro-4-quinolinol
Description:
8-Nitro-4-quinolinol, with the CAS number 23432-46-4, is a chemical compound characterized by its quinoline structure, which features a nitro group at the 8-position and a hydroxyl group at the 4-position. This compound is known for its potential applications in medicinal chemistry, particularly as an antimicrobial and antifungal agent. The presence of the nitro group enhances its reactivity and biological activity, while the hydroxyl group contributes to its solubility and interaction with biological targets. 8-Nitro-4-quinolinol exhibits properties typical of quinoline derivatives, including the ability to chelate metal ions, which can influence its pharmacological effects. Additionally, it may exhibit fluorescence, making it useful in various analytical applications. As with many nitro-containing compounds, it is essential to handle 8-nitro-4-quinolinol with care due to potential toxicity and environmental concerns. Overall, this compound represents a significant interest in research for its diverse chemical properties and potential therapeutic applications.
Formula:C9H6N2O3
InChI:InChI=1S/C9H6N2O3/c12-8-4-5-10-9-6(8)2-1-3-7(9)11(13)14/h1-5H,(H,10,12)
InChI key:InChIKey=MMLGHJCPFCGNEY-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C2=C(C(O)=CC=N2)C=CC1
Synonyms:- 8-Nitro-4-quinolinol
- 4-Quinolinol, 8-nitro-
- 4-Hydroxy-8-nitroquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

