CAS 23432-94-2
:3-Bromo-5-phenyl-1,2,4-oxadiazole
Description:
3-Bromo-5-phenyl-1,2,4-oxadiazole is a heterocyclic organic compound characterized by its oxadiazole ring, which consists of two nitrogen atoms and one oxygen atom within a five-membered ring structure. The presence of a bromine atom at the 3-position and a phenyl group at the 5-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may show limited solubility in water due to its hydrophobic phenyl group. It is often utilized in various fields, including pharmaceuticals and materials science, due to its potential biological activity and ability to participate in further chemical reactions. The bromine substituent can enhance reactivity, making it a useful intermediate in synthetic organic chemistry. Additionally, compounds like 3-Bromo-5-phenyl-1,2,4-oxadiazole may exhibit interesting photophysical properties, which can be exploited in the development of organic electronic devices or fluorescent materials. As with many chemical substances, handling should be done with care, considering safety data and potential hazards associated with brominated compounds.
Formula:C8H5BrN2O
InChI:InChI=1S/C8H5BrN2O/c9-8-10-7(12-11-8)6-4-2-1-3-5-6/h1-5H
InChI key:InChIKey=WJLDWMUZNIQXET-UHFFFAOYSA-N
SMILES:BrC=1N=C(ON1)C2=CC=CC=C2
Synonyms:- 3-Bromo-5-phenyl-1,2,4-oxadiazole
- 1,2,4-Oxadiazole, 3-bromo-5-phenyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,2,4-Oxadiazole, 3-bromo-5-phenyl-
CAS:Formula:C8H5BrN2OPurity:%Color and Shape:SolidMolecular weight:225.04213-Bromo-5-phenyl-1,2,4-oxadiazole
CAS:3-Bromo-5-phenyl-1,2,4-oxadiazolePurity:95%Molecular weight:225.05g/mol3-bromo-5-phenyl-1,2,4-oxadiazole
CAS:Formula:C8H5BrN2OPurity:95+%Color and Shape:Solid, Light beige powderMolecular weight:225.0453-Bromo-5-phenyl-1,2,4-oxadiazole
CAS:3-Bromo-5-phenyl-1,2,4-oxadiazole (3BrO) is an organic compound that can be synthesized by coupling a benzoyl chloride with a cyanide salt. 3BrO is also produced in the pyrolysis of benzophenone and 1,2,4-triazole. The fragmentation of 3BrO produces catechol and phenylhydrazine. The deoxygenative coupling reaction of 3BrO with sodium azide produces the explosive compound 2,4,6-trinitrobenzamide. This chemical has been used as the starting material for the synthesis of many other explosives such as RDX and TNT.
Formula:C8H5BrN2OPurity:Min. 95%Molecular weight:225.04 g/mol



