CAS 23433-05-8

1,3-Octanediol

Description:

1,3-Octanediol is a straight-chain aliphatic diol with the molecular formula C8H18O2. It features two hydroxyl (-OH) functional groups located at the first and third carbon atoms of the octane chain, which contributes to its classification as a diol. This compound is typically a colorless, viscous liquid at room temperature and is known for its mild odor. It is soluble in water and organic solvents, making it versatile for various applications. 1,3-Octanediol is primarily used in the production of surfactants, lubricants, and as a solvent in chemical processes. Additionally, it has potential applications in the cosmetic and personal care industries due to its moisturizing properties. The compound is generally considered to have low toxicity, but safety data should always be consulted for handling and usage guidelines. Its unique structure and properties make it an interesting subject of study in organic chemistry and industrial applications.

Formula: C₈H₁₈O₂

InChI: InChI=1S/C8H18O2/c1-2-3-4-5-8(10)6-7-9/h8-10H,2-7H2,1H3

InChI key: InChIKey=DCTMXCOHGKSXIZ-UHFFFAOYSA-N

SMILES: C(C(CCO)O)CCCC

Synonyms:

• 1,3-Dihydroxyoctane
• 1,3-Octanediol
• Propane-1,3-diol, 1-pentyl-

1,3-Octanediol

CAS: 23433-05-8

Formula: C₈H₁₈O₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 146.2273

Ref: IN-DA002N7W

1,3-Octanediol

CAS: 23433-05-8

1,3-Octanediol is an acidic compound that is commonly used in polymers and research chemicals. It can be synthesized by the reaction of methanol with 1,6-hexanediol or by the hydrogenation of phenol. 1,3-Octanediol has a hydroxyl group at each end of its molecular structure, which makes it a versatile compound for various applications.

Formula: C₈H₁₈O₂

Purity: Min. 95%

Molecular weight: 146.22 g/mol

Ref: 3D-YAA43305