CAS 23433-07-0
:1,3-Nonanediol
Description:
1,3-Nonanediol is a linear aliphatic diol with the molecular formula C9H20O2. It features two hydroxyl (-OH) groups located at the first and third carbon atoms of a nonane chain, which contributes to its classification as a diol. This compound is typically a colorless, viscous liquid at room temperature and is known for its mild odor. It is soluble in water and organic solvents, making it versatile for various applications. 1,3-Nonanediol is utilized in the production of surfactants, lubricants, and as a potential intermediate in the synthesis of other chemical compounds. Its hydroxyl groups allow for hydrogen bonding, which enhances its solubility and reactivity. Additionally, it has been studied for its potential use in cosmetics and personal care products due to its moisturizing properties. Safety data indicates that it should be handled with care, as with many chemical substances, to avoid skin and eye irritation. Overall, 1,3-Nonanediol is a valuable compound in both industrial and research settings.
Formula:C9H20O2
InChI:InChI=1S/C9H20O2/c1-2-3-4-5-6-9(11)7-8-10/h9-11H,2-8H2,1H3
InChI key:InChIKey=CGNJFUJNEYIYRZ-UHFFFAOYSA-N
SMILES:C(CCCCCC)(CCO)O
Synonyms:- (±)-1,3-Nonanediol
- 1,3-Nonanediol
- 1,3-Dihydroxynonane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
