CAS 23434-88-0
:Tetrahydropiperine
Description:
Tetrahydropiperine is a chemical compound characterized by its piperidine structure, which is a six-membered ring containing five carbon atoms and one nitrogen atom. It is a derivative of piperine, the active component found in black pepper, and is known for its potential bioactive properties. Tetrahydropiperine is typically a colorless to pale yellow liquid with a characteristic odor. It is soluble in organic solvents but has limited solubility in water. This compound has garnered interest in various fields, including pharmacology and food science, due to its potential to enhance the bioavailability of certain nutrients and drugs. Additionally, it may exhibit antioxidant and anti-inflammatory properties, making it a subject of research for various health-related applications. Its CAS number, 23434-88-0, is used for identification in chemical databases and regulatory frameworks. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.
Formula:C17H23NO3
InChI:InChI=1S/C17H23NO3/c19-17(18-10-4-1-5-11-18)7-3-2-6-14-8-9-15-16(12-14)21-13-20-15/h8-9,12H,1-7,10-11,13H2
InChI key:InChIKey=APZYKUZPJCQGPP-UHFFFAOYSA-N
SMILES:C(CCCC(=O)N1CCCCC1)C=2C=C3C(=CC2)OCO3
Synonyms:- 1-Pentanone, 5-(1,3-Benzodioxol-5-Yl)-1-(1-Piperidinyl)-
- 1-[5-(1,3-Benzodioxol-5-yl)pentanoyl]piperidine
- 5-(1,3-Benzodioxol-5-yl)-1-(1-piperidinyl)-1-pentanone
- Cosmoperine
- Piperidine, 1-[5-(1,3-benzodioxol-5-yl)-1-oxopentyl]-
- Piperidine, 1-[5-[3,4-(methylenedioxy)phenyl]valeryl]-
- Tetrahydropiperidine
- Tetrahydropiperine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
1-Pentanone, 5-(1,3-benzodioxol-5-yl)-1-(1-piperidinyl)-
CAS:Formula:C17H23NO3Purity:98%Color and Shape:SolidMolecular weight:289.36945-(Benzo[D][1,3]Dioxol-5-Yl)-1-(Piperidin-1-Yl)Pentan-1-One
CAS:<p>5-(Benzo[D][1,3]Dioxol-5-Yl)-1-(Piperidin-1-Yl)Pentan-1-One</p>Purity:99%Molecular weight:289.37g/molTETRAHYDROPIPERINE
CAS:Tetrahydropiperine (Cosmoperine) is a natural product derived from piperine, can be used to treat convulsion, epilepsy, relieve pain, and control insects.Formula:C17H23NO3Purity:98.04% - 99.61%Color and Shape:Off-White Low Melting Solid With Characteristic OdourMolecular weight:289.37Tetrahydropiperine
CAS:Natural alkaloidFormula:C17H23NO3Purity:≥ 90.0 % (HPLC)Color and Shape:Oily liquidMolecular weight:289.37Tetrahydropiperine
CAS:<p>Tetrahydropiperine is a versatile compound with various characteristics and applications. It acts as a 2-adrenergic receptor antagonist, making it useful in the development of herbicides and diuretics. Additionally, it has been shown to enhance the activity of furosemide, a commonly used diuretic. Tetrahydropiperine also exhibits reactive properties and has been studied for its potential intraocular use.</p>Formula:C17H23NO3Purity:Min. 95%Molecular weight:289.37 g/mol
![5-(Benzo[D][1,3]Dioxol-5-Yl)-1-(Piperidin-1-Yl)Pentan-1-One](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fproducts%2F54%2Fthumb%2FOR1027405.jpg&w=3840&q=75)
