CAS 23438-11-1
:2-Methyl-2-(4-methylphenoxy)propanoic acid
Description:
2-Methyl-2-(4-methylphenoxy)propanoic acid, with the CAS number 23438-11-1, is an organic compound characterized by its structure, which includes a propanoic acid backbone substituted with a methyl group and a 4-methylphenoxy group. This compound typically appears as a white to off-white solid and is soluble in organic solvents, while its solubility in water is limited due to its hydrophobic aromatic component. It exhibits acidic properties due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, such as esterification and neutralization. The presence of the aromatic ring contributes to its stability and may influence its reactivity and interactions with other substances. This compound is often studied for its potential applications in pharmaceuticals, agrochemicals, or as a biochemical tool, although specific applications may vary. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper safety measures are taken.
Formula:C11H14O3
InChI:InChI=1S/C11H14O3/c1-8-4-6-9(7-5-8)14-11(2,3)10(12)13/h4-7H,1-3H3,(H,12,13)
InChI key:InChIKey=OQUCRQLGCRZSBH-UHFFFAOYSA-N
SMILES:O(C(C(O)=O)(C)C)C1=CC=C(C)C=C1
Synonyms:- 2-Methyl-2-(p-tolyloxy)propanoic acid
- 2-Methyl-2-p-tolyloxy-propionic acid
- Propanoic acid, 2-methyl-2-(4-methylphenoxy)-
- Propionic acid, 2-methyl-2-(p-tolyloxy)-
- 2-Methyl-2-(4-methylphenoxy)propanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Methyl-2-(p-tolyloxy)propanoic acid
CAS:2-Methyl-2-(p-tolyloxy)propanoic acidPurity:96%Molecular weight:194.23g/mol2-Methyl-2-(4-methylphenoxy)propanoic acid
CAS:<p>2-Methyl-2-(4-methylphenoxy)propanoic acid is a chemical building block that is used in the synthesis of drugs, pesticides, and dyes. 2-Methyl-2-(4-methylphenoxy)propanoic acid is a versatile intermediate for the production of complex compounds with many different functional groups. This compound can be converted to a variety of other compounds through reactions such as esterification or alkylation. 2-Methyl-2-(4-methylphenoxy)propanoic acid has a high quality and purity, making it an excellent reagent for research purposes. It is also useful in the synthesis of speciality chemicals, such as fragrances and flavours.</p>Formula:C11H14O3Purity:Min. 95%Color and Shape:PowderMolecular weight:194.23 g/mol




