CAS 234445-61-5

2-Isopropyl-1,3-thiazole-4-carboxylic acid

Description:

2-Isopropyl-1,3-thiazole-4-carboxylic acid is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features an isopropyl group at the 2-position and a carboxylic acid functional group at the 4-position of the thiazole ring. It is typically a solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid group. The thiazole moiety contributes to its potential biological activity, making it of interest in pharmaceutical and agrochemical research. The compound may exhibit various properties such as antimicrobial or antifungal activity, which are common in thiazole derivatives. Its molecular structure allows for potential interactions with biological targets, making it a candidate for further investigation in medicinal chemistry. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₇H₉NO₂S

InChI: InChI=1/C7H9NO2S/c1-4(2)6-8-5(3-11-6)7(9)10/h3-4H,1-2H3,(H,9,10)

SMILES: CC(C)c1nc(cs1)C(=O)O

Synonyms:

• 4-Thiazolecarboxylic Acid, 2-(1-Methylethyl)-
• 2-(Propan-2-Yl)-1,3-Thiazole-4-Carboxylic Acid
• 2-Isopropyl-4-Carboxylic Acid Thiazol

4-Thiazolecarboxylic acid, 2-(1-methylethyl)-

CAS: 234445-61-5

Formula: C₇H₉NO₂S

Purity: 96%

Color and Shape: Solid

Molecular weight: 171.2169

Ref: IN-DA002N94

2-Isopropyl-1,3-thiazole-4-carboxylic acid

CAS: 234445-61-5

2-Isopropyl-1,3-thiazole-4-carboxylic acid

Purity: 98%

Molecular weight: 171.22g/mol

Ref: 54-OR943371

2-Isopropylthiazole-4-carboxylic acid

CAS: 234445-61-5

Formula: C₇H₉NO₂S

Purity: 96%

Color and Shape: Solid

Molecular weight: 171.21

Ref: 10-F220493