CAS 2345-17-7: Irisolidone
Description:Irisolidone, with the CAS number 2345-17-7, is a naturally occurring compound classified as a flavonoid. It is primarily derived from various plant sources, particularly those in the Iris genus. This compound exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties, making it of interest in pharmacological research. Irisolidone is characterized by its phenolic structure, which contributes to its reactivity and interaction with biological systems. In terms of solubility, it is generally soluble in organic solvents but may have limited solubility in water. The compound's stability can be influenced by environmental factors such as light and pH. Additionally, irisolidone's potential applications in herbal medicine and dietary supplements are being explored, given its bioactive properties. However, further studies are necessary to fully understand its mechanisms of action and therapeutic potential. As with many natural products, the extraction and purification processes can significantly affect its yield and efficacy.
Formula:C17H14O6
InChI:InChI=1S/C17H14O6/c1-21-10-5-3-9(4-6-10)11-8-23-13-7-12(18)17(22-2)16(20)14(13)15(11)19/h3-8,18,20H,1-2H3
InChI key:InChIKey=VOOFPOMXNLNEOF-UHFFFAOYSA-N
SMILES:O=C1C(=COC2=CC(O)=C(OC)C(O)=C12)C=3C=CC(OC)=CC3
- Synonyms:
- 4H-1-benzopyran-4-one, 5,7-dihydroxy-6-methoxy-3-(4-methoxyphenyl)-
- 4′-Methoxytectorigenin
- 4′-O-Methyltectorigenin
- 5,7-Dihydroxy-6-methoxy-3-(4-methoxyphenyl)-4H-1-benzopyran-4-one
- Irisoidone
- Irisolidone
- Isoflavone, 5,7-dihydroxy-4′,6-dimethoxy-
