CymitQuimica logo

CAS 23466-29-7

:

4-Ethyl-3-methyl-1H-pyrrole-2-carboxylic acid

Description:
4-Ethyl-3-methyl-1H-pyrrole-2-carboxylic acid is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features an ethyl group and a methyl group attached to the pyrrole ring, contributing to its unique properties. The carboxylic acid functional group (-COOH) at the second position of the pyrrole ring imparts acidic characteristics, making it capable of donating protons in solution. This compound is likely to exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group, while its aromatic nature may provide some degree of hydrophobicity. Additionally, the presence of substituents can influence its reactivity, stability, and potential applications in organic synthesis or as a building block in pharmaceuticals. As with many pyrrole derivatives, it may also exhibit biological activity, although specific biological properties would require further investigation. Safety data and handling precautions should be consulted, as with any chemical substance.
Formula:C8H11NO2
InChI:InChI=1S/C8H11NO2/c1-3-6-4-9-7(5(6)2)8(10)11/h4,9H,3H2,1-2H3,(H,10,11)
InChI key:InChIKey=CUWQXJFQBYKZFD-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C)C(CC)=CN1
Synonyms:
  • 4-Ethyl-3-methyl-1H-pyrrole-2-carboxylic acid
  • 1H-Pyrrole-2-carboxylic acid, 4-ethyl-3-methyl-
  • Pyrrole-2-carboxylic acid, 4-ethyl-3-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.