CAS 23467-27-8

Bis[2-(2-benzoxazolyl)phenolato]zinc (II)

Description:

Bis[2-(2-benzoxazolyl)phenolato]zinc(II), with the CAS number 23467-27-8, is a coordination compound featuring zinc as the central metal ion coordinated to two bidentate ligands derived from 2-(2-benzoxazolyl)phenol. This compound typically exhibits a complex structure where the ligands form chelate rings with the zinc ion, enhancing stability. It is characterized by its potential applications in various fields, including materials science and biochemistry, due to its luminescent properties and ability to act as a catalyst or a precursor in organic synthesis. The presence of the benzoxazole moiety contributes to its photophysical properties, making it of interest in the development of organic light-emitting diodes (OLEDs) and other optoelectronic devices. Additionally, the compound may exhibit biological activity, which warrants further investigation into its potential therapeutic applications. Its solubility and stability in different solvents can vary, influencing its reactivity and utility in various chemical processes.

Formula: C₂₆H₁₆N₂O₄Zn

InChI: InChI=1/2C13H9NO2.Zn/c2*15-11-7-3-1-5-9(11)13-14-10-6-2-4-8-12(10)16-13;/h2*1-8,15H;/q;;+2/p-2

SMILES: c1ccc(c(c1)c1nc2ccccc2o1)O.c1ccc(c(c1)c1nc2ccccc2o1)O.[Zn]

Synonyms:

• Phenol, 2-(2-Benzoxazolyl)-, Zinc Salt (2:1)
• Zinc Bis[2-(1,3-Benzoxazol-2-Yl)Phenolate]
• Bis[2-(2-Benzoxazoly)Phenolato]Zinc(Ii)
• Bis[2-(2-Benzoxazolyl)Phenolato]Zinc(Ii)

Bis[2-(2-benzoxazolyl)phenolato]zinc(II)

CAS: 23467-27-8

Formula: C₂₆H₁₆N₂O₄Zn

Purity: >97.0%(T)(NMR)

Color and Shape: Light yellow to Amber to Dark green powder to crystal

Molecular weight: 485.80

Ref: 3B-B2078

Bis[2-(2-benzoxazolyl)phenolato]zinc(II)

CAS: 23467-27-8

Formula: C₂₆H₁₈N₂O₄Zn

Purity: 97%

Color and Shape: Solid

Molecular weight: 487.8121

Ref: IN-DA003OD9