CAS 23474-61-5

2-amino-10-ethyldibenzo[b,f][1,4]oxazepin-11(10H)-one

Description:

2-Amino-10-ethyldibenzo[b,f][1,4]oxazepin-11(10H)-one is a chemical compound characterized by its complex bicyclic structure, which includes an oxazepine ring fused to two benzene rings. This compound features an amino group and an ethyl substituent, contributing to its unique chemical properties. It is typically classified as a heterocyclic compound due to the presence of nitrogen and oxygen in its ring structure. The presence of the amino group suggests potential for hydrogen bonding, which may influence its solubility and reactivity. The compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its CAS number, 23474-61-5, allows for easy identification and reference in chemical databases. Overall, 2-amino-10-ethyldibenzo[b,f][1,4]oxazepin-11(10H)-one is notable for its structural complexity and potential applications in various fields, including drug development and organic synthesis.

Formula: C₁₅H₁₄N₂O₂

InChI: InChI=1/C15H14N2O2/c1-2-17-12-5-3-4-6-14(12)19-13-8-7-10(16)9-11(13)15(17)18/h3-9H,2,16H2,1H3

SMILES: CCN1c2ccccc2Oc2ccc(cc2C1=O)N

2-amino-10-ethyldibenzo[b,f][1,4]oxazepin-11(10H)-one

CAS: 23474-61-5

Purity: 95.0%

Molecular weight: 254.28900146484375

Ref: 10-F496237