CAS 23474-62-6
:2-Amino-10-methyldibenz[b,f][1,4]oxazepin-11(10H)-one
Description:
2-Amino-10-methyldibenz[b,f][1,4]oxazepin-11(10H)-one is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both an oxazepine ring and a dibenzene framework. This compound features an amino group at the 2-position and a methyl group at the 10-position, contributing to its chemical reactivity and potential biological activity. The presence of the oxazepine moiety suggests that it may exhibit properties typical of compounds in this class, such as potential neuroactive effects. The molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its solubility and stability. Additionally, the compound may be of interest in medicinal chemistry due to its structural similarity to other bioactive molecules. Its CAS number, 23474-62-6, facilitates its identification in chemical databases and literature. Overall, 2-Amino-10-methyldibenz[b,f][1,4]oxazepin-11(10H)-one represents a complex and potentially valuable compound for further research in pharmacology and organic synthesis.
Formula:C14H12N2O2
InChI:InChI=1S/C14H12N2O2/c1-16-11-4-2-3-5-13(11)18-12-7-6-9(15)8-10(12)14(16)17/h2-8H,15H2,1H3
InChI key:InChIKey=SOZVMXIKFABVBR-UHFFFAOYSA-N
SMILES:O=C1C=2C(OC=3C(N1C)=CC=CC3)=CC=C(N)C2
Synonyms:- 2-Amino-10-methyldibenz[b,f][1,4]oxazepin-11(10H)-one
- Dibenz[b,f][1,4]oxazepin-11(10H)-one, 2-amino-10-methyl-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery