CAS 23489-36-3
:1-(1-benzofuran-2-yl)-2-bromoethanone
Description:
1-(1-benzofuran-2-yl)-2-bromoethanone, with the CAS number 23489-36-3, is an organic compound characterized by its unique structure that includes a benzofuran moiety and a bromoethanone functional group. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its potential applications in organic synthesis and medicinal chemistry. The presence of the bromine atom enhances its reactivity, making it a useful intermediate in various chemical reactions, such as nucleophilic substitutions. The benzofuran ring contributes to its aromatic properties, which can influence its solubility and stability in different solvents. Additionally, compounds like this may exhibit biological activity, making them of interest in pharmacological research. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 1-(1-benzofuran-2-yl)-2-bromoethanone is a versatile compound with significant implications in chemical research and development.
Formula:C10H7BrO2
InChI:InChI=1/C10H7BrO2/c11-6-8(12)10-5-7-3-1-2-4-9(7)13-10/h1-5H,6H2
SMILES:c1ccc2c(c1)cc(C(=O)CBr)o2
Synonyms:- 1-Benzofuran-2-yl-2-bromo-ethanone
- 2-(2-Bromoacetyl)benzofuran
- Ethanone, 1-(2-benzofuranyl)-2-bromo-
- 1-(1-Benzofuran-2-yl)-2-bromoethanone
- 1-(1-Benzofuran-2-yl)-2-bromoethan-1-one ,97%
- AKOS BBS-00004078
- 1-(1-BENZOFURAN-2-YL)-2-BROMOETHAN-1-ONE
- 2-(2-Bromoacetyl)benzo[b]furan
- 1-(1-Benzofuran-2-yl)-2-bromoethan-1-one, GC 90+%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ethanone, 1-(2-benzofuranyl)-2-bromo-
CAS:Formula:C10H7BrO2Purity:96%Color and Shape:SolidMolecular weight:239.06542-(Bromoacetyl)benzo[b]furan
CAS:2-(Bromoacetyl)benzo[b]furanPurity:95%Color and Shape:Yellow SolidMolecular weight:239.07g/mol1-(Benzofuran-2-yl)-2-bromoethan-1-one
CAS:Formula:C10H7BrO2Purity:>98.0%(GC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:239.071-(1-Benzofuran-2-yl)-2-bromoethan-1-one
CAS:1-(1-Benzofuran-2-yl)-2-bromoethan-1-one is a fine chemical that can be used as a building block for research and as a reagent in the synthesis of other compounds. It has been shown to be an effective intermediate, useful scaffold, and reaction component in the synthesis of complex compounds. This product is commercially available with CAS No. 23489-36-3.Formula:C10H14N4O2Molecular weight:222.24 g/mol




