CymitQuimica logo

CAS 23491-44-3

:

Bisbenzimidazole

Description:
Bisbenzimidazole is an organic compound characterized by its structure, which consists of two benzimidazole units linked together. This compound typically exhibits a high degree of stability and is known for its strong fluorescence properties, making it useful in various applications, including as a fluorescent probe in biochemical assays. Bisbenzimidazole derivatives often display significant biological activity, including antimicrobial and anticancer properties, which has led to interest in their potential therapeutic uses. The compound is generally soluble in organic solvents but may have limited solubility in water, depending on the specific substituents present. Its chemical behavior is influenced by the presence of nitrogen atoms in the benzimidazole rings, which can participate in hydrogen bonding and coordination with metal ions. Overall, bisbenzimidazole serves as an important scaffold in medicinal chemistry and materials science, with ongoing research exploring its diverse applications and modifications to enhance its properties.
Formula:C25H24N6O
InChI:InChI=1S/C25H24N6O/c1-30-10-12-31(13-11-30)18-5-9-21-23(15-18)29-25(27-21)17-4-8-20-22(14-17)28-24(26-20)16-2-6-19(32)7-3-16/h2-9,14-15,32H,10-13H2,1H3,(H,26,28)(H,27,29)
InChI key:InChIKey=INAAIJLSXJJHOZ-UHFFFAOYSA-N
SMILES:CN1CCN(C=2C=C3NC(=NC3=CC2)C=4C=C5C(=CC4)N=C(N5)C6=CC=C(O)C=C6)CC1
Synonyms:
  • 4-[5-(4-Methyl-1-piperazinyl)[2,5′-bi-1H-benzimidazol]-2′-yl]phenol
  • 2-[2-(4-Hydroxyphenyl)-6-benzimidazolyl]-6-(1-methyl-4-piperazinyl)benzimidazole
  • Phenol, p-[5-[5-(4-methyl-1-piperazinyl)-2-benzimidazolyl]-2-benzimidazolyl]-
  • Phenol, 4-[5-(4-methyl-1-piperazinyl)[2,5′-bi-1H-benzimidazol]-2′-yl]-
  • 2-[2-(4-Hydroxyphenyl)-6-benzimidazolyl]-6-(1-methyl-4-piperazyl)benzimidazole
Found 4 products.