
CAS 23495-64-9
:Ergoline-8-carboxylic acid, 10-methoxy-6-methyl-, methyl ester, (8β)-
Description:
Ergoline-8-carboxylic acid, 10-methoxy-6-methyl-, methyl ester, with the CAS number 23495-64-9, is a chemical compound belonging to the ergoline family, which is characterized by a tetracyclic structure derived from the indole alkaloids. This compound features a carboxylic acid functional group and a methoxy group, contributing to its unique chemical properties. Ergoline derivatives are often noted for their biological activity, including potential effects on the central nervous system. The presence of the methyl ester indicates that it can undergo hydrolysis to release the corresponding carboxylic acid, which may enhance its solubility and bioavailability. Additionally, the specific stereochemistry at the 8β position can influence the compound's interaction with biological targets. Overall, ergoline derivatives are of interest in medicinal chemistry and pharmacology due to their diverse range of effects and potential therapeutic applications. However, detailed studies on this specific compound's properties, reactivity, and biological activity would be necessary to fully understand its implications in research and medicine.
Formula:C18H22N2O3
InChI:InChI=1S/C18H22N2O3/c1-20-10-12(17(21)22-2)8-18(23-3)13-5-4-6-14-16(13)11(9-19-14)7-15(18)20/h4-6,9,12,15,19H,7-8,10H2,1-3H3/t12-,15-,18+/m1/s1
InChI key:InChIKey=SCWPBCNOFOVVGZ-DWQUBVKVSA-N
SMILES:O(C)[C@@]12C=3C=4C(C[C@]1(N(C)C[C@H](C(OC)=O)C2)[H])=CNC4C=CC3
Synonyms:- Lumilysergic acid, O-methyl-, methyl ester
- Ergoline-8-carboxylic acid, 10-methoxy-6-methyl-, methyl ester, (8β)-
- Methyl 10α-methoxydihydrolysergate
- Ergoline-8β-carboxylic acid, 10-methoxy-6-methyl-, methyl ester
- Indolo[4,3-fg]quinoline, ergoline-8-carboxylic acid deriv.
- 10α-methoxy-9,10-dihydrolysergic acid methylester
- 0-Methoxy-6-methylergoline-8β-carboxylic acid methyl ester
- 10-Methoxy-6-methylergoline-8β-carboxylic acid methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

