CAS 23496-41-5: Peimine
Description:Peimine is a chemical compound classified as an alkaloid, primarily derived from the plant species *Veratrum* (commonly known as false hellebore). It is known for its structural complexity, featuring a tetracyclic framework that contributes to its biological activity. Peimine exhibits a range of pharmacological effects, including potential anti-inflammatory and analgesic properties, which have garnered interest in medicinal chemistry. The compound interacts with various biological targets, influencing neurotransmitter systems and ion channels. Its solubility characteristics can vary, typically being more soluble in organic solvents than in water, which is common for many alkaloids. Due to its potent biological effects, peimine has been studied for its potential therapeutic applications, although it also requires careful handling due to its toxicity at higher concentrations. As with many natural products, the extraction and purification processes are crucial for obtaining peimine in a form suitable for research or pharmaceutical use. Overall, peimine represents a significant area of interest in both natural product chemistry and pharmacology.
Formula:C27H45NO3
InChI:InChI=1S/C27H45NO3/c1-15-4-7-25-27(3,31)21-6-5-17-18(20(21)14-28(25)13-15)11-22-19(17)12-24(30)23-10-16(29)8-9-26(22,23)2/h15-25,29-31H,4-14H2,1-3H3/t15-,16-,17+,18+,19-,20-,21-,22-,23+,24-,25-,26+,27-/m0/s1
InChI key:InChIKey=IUKLSMSEHKDIIP-BZMYINFQSA-N
SMILES:OC1CCC2(C)C(C1)C(O)CC3C4CCC5C(CN6CC(C)CCC6C5(O)C)C4CC32
- Synonyms:
- (3Beta,5Alpha,6Alpha)-Cevane-3,6,20-Triol
- (3β,5α,6α)-Cevane-3,6,20-triol
- 5α-Cevane-3β,6α,20-triol
- Cevane-3,6,20-triol, (3β,5α,6α)-
- Dihydroisoimperialine
- Verticine
