CAS 2350-31-4

N,N-diethyl-2-[(4-propoxybenzoyl)oxy]ethanaminium chloride

Description:

N,N-Diethyl-2-[(4-propoxybenzoyl)oxy]ethanaminium chloride is a quaternary ammonium compound characterized by its cationic nature due to the presence of a positively charged nitrogen atom. This compound features a diethylamino group, which contributes to its solubility in polar solvents, and a propoxybenzoyl moiety that enhances its hydrophobic characteristics. The presence of the chloride ion as the counterion plays a crucial role in its stability and solubility in aqueous solutions. Typically, quaternary ammonium compounds like this one exhibit surfactant properties, making them useful in various applications, including as antimicrobial agents, emulsifiers, or in drug delivery systems. The structural features suggest potential interactions with biological membranes, which may influence its pharmacological properties. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its practical applications. Overall, N,N-diethyl-2-[(4-propoxybenzoyl)oxy]ethanaminium chloride is a versatile compound with significant implications in both industrial and pharmaceutical contexts.

Formula: C₁₆H₂₆ClNO₃

InChI: InChI=1/C16H25NO3.ClH/c1-4-12-19-15-9-7-14(8-10-15)16(18)20-13-11-17(5-2)6-3;/h7-10H,4-6,11-13H2,1-3H3;1H

Proparacaine Impurity 19 HCl

CAS: 2350-31-4

Formula: C₁₆H₂₅NO₃·HCl

Molecular weight: 279.38 36.46

Ref: 4Z-P-305020

Proparacaine Impurity 19

CAS: 2350-31-4

Formula: C₁₆H₂₅NO₃HCl

Molecular weight: 279.38 : 36.46

Ref: ST-EA-CP-P121017