CAS 23500-17-6
:1-(1-Oxobutyl)proline
Description:
1-(1-Oxobutyl)proline, with the CAS number 23500-17-6, is an amino acid derivative characterized by its proline backbone modified with a 1-oxobutyl group. This compound features a five-membered pyrrolidine ring typical of proline, which is a non-polar, cyclic amino acid. The presence of the 1-oxobutyl substituent introduces a carbonyl group, contributing to its reactivity and potential interactions in biological systems. The molecular structure suggests that it may participate in various biochemical processes, possibly influencing protein folding or enzyme activity due to its structural similarity to natural amino acids. Additionally, the compound's solubility and stability can be influenced by the presence of the carbonyl group, which may also affect its hydrogen bonding capabilities. While specific applications or biological roles may not be extensively documented, compounds of this nature are often explored in medicinal chemistry for their potential therapeutic properties. Overall, 1-(1-Oxobutyl)proline represents an interesting subject for further research in the fields of organic and medicinal chemistry.
Formula:C9H15NO3
InChI:InChI=1S/C9H15NO3/c1-2-4-8(11)10-6-3-5-7(10)9(12)13/h7H,2-6H2,1H3,(H,12,13)
InChI key:InChIKey=PNRXXKVCHJXHPZ-UHFFFAOYSA-N
SMILES:C(CCC)(=O)N1C(C(O)=O)CCC1
Synonyms:- 1-(1-Oxobutyl)proline
- DL-Proline, 1-(1-oxobutyl)-
- Proline, 1-(1-oxobutyl)-
- DL-Butyrylproline
- Proline, 1-butyryl-, DL-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1-Butanoylpyrrolidine-2-carboxylic acid
CAS:1-Butanoylpyrrolidine-2-carboxylic acid is a versatile compound with various applications. It has been used in research as a reactive intermediate for the synthesis of different compounds, including piperonyl butoxide, d-psicose, and polymersomes. This compound has also shown potential in the field of medicine and pharmacology. Studies have suggested that it may have an impact on dopamine and monoamine levels, which could potentially be beneficial for certain neurological conditions. Additionally, 1-Butanoylpyrrolidine-2-carboxylic acid has been investigated for its antioxidant properties and its ability to scavenge superoxide radicals. Its unique chemical structure makes it a valuable tool for researchers exploring the synthesis of copolymers and other complex molecules.Formula:C9H15NO3Purity:Min. 95%Molecular weight:185.22 g/mol
