CAS 23503-68-6: 2-(Methylsulfonyl)-10H-phenothiazine
Description:2-(Methylsulfonyl)-10H-phenothiazine, with the CAS number 23503-68-6, is a chemical compound that belongs to the phenothiazine class, which is characterized by a tricyclic structure containing sulfur and nitrogen atoms. This compound features a methylsulfonyl group (-SO2CH3) attached to the phenothiazine core, which can influence its solubility and reactivity. Typically, phenothiazines exhibit properties such as being weakly basic and can participate in various chemical reactions, including oxidation and reduction. The presence of the methylsulfonyl group may enhance its pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of antipsychotic and antidepressant medications. Additionally, compounds in this class often display biological activity, including antimicrobial and anti-inflammatory effects. The physical properties, such as melting point, boiling point, and solubility, can vary based on the specific structure and substituents, and these characteristics are essential for understanding its potential applications in pharmaceuticals and other fields.
Formula:C13H11NO2S2
InChI:InChI=1S/C13H11NO2S2/c1-18(15,16)9-6-7-13-11(8-9)14-10-4-2-3-5-12(10)17-13/h2-8,14H,1H3
InChI key:InChIKey=XMSALNTWEPZQLO-UHFFFAOYSA-N
SMILES:O=S(=O)(C1=CC=C2SC=3C=CC=CC3NC2=C1)C
- Synonyms:
- 10H-Phenothiazine, 2-(methylsulfonyl)-
- 2-(methylsulfonyl)-10H-phenothiazine
- Phenothiazine, 2-(methylsulfonyl)-
