CAS 2351-14-6
:2-amino-2-deoxyhexitol
Description:
2-Amino-2-deoxyhexitol, with the CAS number 2351-14-6, is a chemical compound that belongs to the class of amino sugars. It is characterized by the presence of an amino group (-NH2) and a hydroxyl group (-OH) attached to a six-carbon sugar backbone. This compound is typically a white crystalline solid and is soluble in water due to its polar functional groups. The amino group imparts basic properties, allowing it to participate in various biochemical reactions, including glycosylation processes. 2-Amino-2-deoxyhexitol is often studied for its potential applications in biochemistry and medicinal chemistry, particularly in the synthesis of glycosides and other derivatives. Its structural features make it a valuable building block in the development of pharmaceuticals and other biologically active compounds. Additionally, it may play a role in metabolic pathways and cellular functions, contributing to its significance in biological research.
Formula:C6H15NO5
InChI:InChI=1/C6H15NO5/c7-3(1-8)5(11)6(12)4(10)2-9/h3-6,8-12H,1-2,7H2
SMILES:C(C(C(C(C(CO)O)O)O)N)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Amino-2-deoxy-glucitol
CAS:2-Amino-2-deoxy-glucitol is a kinetic inhibitor of the enzyme glycogen phosphorylase, which catalyzes the rate-limiting step in glycogenolysis. It binds to the enzyme and blocks access to the active site by an amide group, thus inhibiting the phosphorylation of glucose residues. This prevents the breakdown of glycogen and leads to increased levels of blood sugar. 2-Amino-2-deoxy-glucitol is used as a treatment for pertussis (whooping cough) and as an adjunct therapy during insulin shock therapy for diabetic ketoacidosis. The drug has also been shown to bind to histidine residues on the enzyme and inhibit its activity.Formula:C6H15NO5Purity:Min. 95%Molecular weight:181.19 g/mol
