CAS 2351-33-9: 1,1-dichlorosilacyclobutane
Description:1,1-Dichlorosilacyclobutane is a chemical compound characterized by its unique structure, which includes a silicon atom integrated into a four-membered cyclic structure. The presence of two chlorine atoms attached to the silicon atom significantly influences its reactivity and properties. This compound is typically a colorless to pale yellow liquid at room temperature and exhibits a relatively low boiling point compared to larger silacyclobutane derivatives. Its molecular structure contributes to its potential applications in organic synthesis and materials science, particularly in the development of silicon-containing polymers and as a precursor for silicon-based materials. The compound is sensitive to moisture and air, necessitating careful handling and storage under inert conditions. Additionally, due to the presence of chlorine, it may exhibit some level of toxicity and environmental concerns, requiring appropriate safety measures during use. Overall, 1,1-dichlorosilacyclobutane is an interesting compound within the field of organosilicon chemistry, with potential utility in various chemical applications.
Formula:C3H6Cl2Si
InChI:InChI=1S/C3H6Cl2Si/c4-6(5)2-1-3-6/h1-3H2
InChI key:InChIKey=PASYEMKYRSIVTP-UHFFFAOYSA-N
SMILES:Cl[Si]1(Cl)CCC1
- Synonyms:
- 1,1-Dichloro-1-silacyclobutane
- 1,1-Dichlorosiletane
- Cyclotrimethylenedichlorosilane
- Silacyclobutane, 1,1-dichloro-
- 1,1-Dichlorosilacyclobutane
- 1,1-Dichlorosilacyclobutane
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1,1-Dichlorosilacyclobutane REF: 3B-D5198CAS: 2351-33-9 | >98.0%(GC)(T) | 101.00 € | Mon 07 Apr 25 |
![]() | Silacyclobutane, 1,1-dichloro- REF: IN-DA002NH2CAS: 2351-33-9 | 95% | To inquire | Mon 14 Apr 25 |
![]() | CYCLOTRIMETHYLENEDICHLOROSILANE REF: 3H-SIC2568.0CAS: 2351-33-9 | 97% | - - - | Discontinued product |
![]() | 1,1-Dichlorosilacyclobutane REF: 3D-FD166220CAS: 2351-33-9 | Min. 95% | - - - | Discontinued product |

1,1-Dichlorosilacyclobutane
Ref: 3B-D5198
1g | 101.00 € |

CYCLOTRIMETHYLENEDICHLOROSILANE
Ref: 3H-SIC2568.0
10g | Discontinued | Request information | |
50g | Discontinued | Request information |

1,1-Dichlorosilacyclobutane
Ref: 3D-FD166220
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information |