
CAS 235101-44-7
:2-Benzothiazolamine, 5-(trifluoromethoxy)-, hydrochloride (1:1)
Description:
2-Benzothiazolamine, 5-(trifluoromethoxy)-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a benzothiazole moiety and a trifluoromethoxy group. The presence of the hydrochloride indicates that it is a salt form, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceuticals and agrochemicals. This compound typically exhibits properties such as moderate to high stability under standard conditions, and its trifluoromethoxy group may impart specific electronic and steric effects that influence its reactivity and biological activity. The benzothiazole ring is known for its role in various biological activities, including antimicrobial and anticancer properties. As with many chemical substances, safety data should be consulted, as it may pose hazards such as irritation or toxicity. Overall, 2-Benzothiazolamine, 5-(trifluoromethoxy)-, hydrochloride is a compound of interest in research and development, particularly in the fields of medicinal chemistry and material science.
Formula:C8H5F3N2OS·ClH
InChI:InChI=1S/C8H5F3N2OS.ClH/c9-8(10,11)14-4-1-2-6-5(3-4)13-7(12)15-6;/h1-3H,(H2,12,13);1H
InChI key:InChIKey=RKNOPWNDKMNVJC-UHFFFAOYSA-N
SMILES:NC=1SC=2C(=CC(OC(F)(F)F)=CC2)N1.Cl
Synonyms:- 2-Benzothiazolamine, 5-(trifluoromethoxy)-, monohydrochloride
- 2-Benzothiazolamine, 5-(trifluoromethoxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Riluzole Impurity 1 HCl
CAS:Formula:C8H5F3N2OS·HClColor and Shape:White To Off-White SolidMolecular weight:234.20 36.46
