CAS 235106-12-4: 4-Chloro-3-methyl-5-(trifluoromethyl)-1H-pyrazole
Description:4-Chloro-3-methyl-5-(trifluoromethyl)-1H-pyrazole is a heterocyclic organic compound characterized by its pyrazole ring structure, which consists of two adjacent nitrogen atoms within a five-membered ring. This compound features a chloro substituent at the 4-position, a methyl group at the 3-position, and a trifluoromethyl group at the 5-position, contributing to its unique chemical properties. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in pharmaceutical and agrochemical research. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its reactivity can be attributed to the electron-withdrawing nature of the trifluoromethyl and chloro groups, which can affect its behavior in chemical reactions. Additionally, the compound may have applications in the development of herbicides or other agrochemicals due to its structural characteristics. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact.
Formula:C5H4ClF3N2
InChI:InChI=1S/C5H4ClF3N2/c1-2-3(6)4(11-10-2)5(7,8)9/h1H3,(H,10,11)
InChI key:InChIKey=KNTOBPVSOYISFT-UHFFFAOYSA-N
SMILES:FC(F)(F)C=1NN=C(C1Cl)C
- Synonyms:
- 1H-Pyrazole, 4-chloro-3-methyl-5-(trifluoromethyl)-
- 1H-Pyrazole, 4-chloro-5-methyl-3-(trifluoromethyl)-
- 4-Chloro-3-methyl-5-(trifluoromethyl)-1H-pyrazole
- 4-Chloro-3-methyl-5-trifluoromethylpyrazole
- 4-Chloro-5-methyl-3-(trifluoromethyl)pyrazole
- 4-Chloro-5-methyl-3-(trifluoromethyl)-1H-pyrazole
- 4-Chloro-5-methyl-3-(trifluoromethyl)-1H-pyrazole

1H-Pyrazole, 4-chloro-3-methyl-5-(trifluoromethyl)-
Ref: IN-DA002NI1
Undefined size | To inquire |

Ref: FT-C14478
1g | To inquire |

4-Chloro-5-methyl-3-(trifluoromethyl)-1H-pyrazole
Ref: 54-PC2074E
1g | 249.00 € | ||
5g | 431.00 € |

4-Chloro-5-Methyl-3-(Trifluoromethyl)-1H-Pyrazole
Ref: 3D-FC91588
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information |