
CAS 23512-53-0
:4,5-Dihydropiperlonguminine
Description:
4,5-Dihydropiperlonguminine is an alkaloid derived from the plant species of the Piper genus, particularly known for its presence in Piper longum. This compound is characterized by its unique bicyclic structure, which includes a piperidine ring. It exhibits a range of biological activities, including potential anti-inflammatory, analgesic, and antimicrobial properties, making it of interest in pharmacological research. The compound's molecular formula reflects its nitrogen-containing structure, which is typical of many alkaloids. Its solubility properties can vary, often being soluble in organic solvents while having limited solubility in water. The compound's synthesis and extraction from natural sources are subjects of ongoing research, particularly in the context of its therapeutic potential. Additionally, its interactions with biological systems, including enzyme inhibition and receptor binding, are areas of active investigation, contributing to the understanding of its mechanism of action and potential applications in medicine. Overall, 4,5-Dihydropiperlonguminine represents a fascinating subject within the field of natural product chemistry and pharmacology.
Formula:C16H21NO3
InChI:InChI=1S/C16H21NO3/c1-12(2)10-17-16(18)6-4-3-5-13-7-8-14-15(9-13)20-11-19-14/h4,6-9,12H,3,5,10-11H2,1-2H3,(H,17,18)/b6-4+
InChI key:InChIKey=CSGDXLXTJVRNEA-GQCTYLIASA-N
SMILES:C(C/C=C/C(NCC(C)C)=O)C=1C=C2C(=CC1)OCO2
Synonyms:- 2-Pentenamide, N-isobutyl-5-[3,4-(methylenedioxy)phenyl]-
- Δα,β-Dihydropiperlonguminine
- (2E)-5-(1,3-Benzodioxol-5-yl)-N-(2-methylpropyl)-2-pentenamide
- 2-Pentenamide, 5-(1,3-benzodioxol-5-yl)-N-(2-methylpropyl)-, (E)-
- 2-Pentenamide, 5-(1,3-benzodioxol-5-yl)-N-(2-methylpropyl)-, (2E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Pentenamide, 5-(1,3-benzodioxol-5-yl)-N-(2-methylpropyl)-, (2E)-
CAS:Formula:C16H21NO3Purity:95%Color and Shape:SolidMolecular weight:275.34284,5-Dihydropiperlonguminine
CAS:4,5-Dihydropiperlonguminine (Dihydropiperlonguminine) is an isolate from Piper tuberculatum Jacq that has insecticidal and potentially analgesic activity.Formula:C16H21NO3Purity:99.51%Color and Shape:SolidMolecular weight:275.34Ref: TM-TN6110
1mg409.00€2mg602.00€5mg945.00€10mg1,279.00€25mg1,882.00€50mg2,565.00€1mL*10mM (DMSO)982.00€4,5-Dihydropiperlonguminine
CAS:4,5-Dihydropiperlonguminine is a bioactive alkaloid, which is derived from the fruit of Piper longum, commonly known as long pepper. This compound is characterized as a natural product with significant pharmacological interest. It originates from a widely studied plant in the Piperaceae family, known for its array of bioactive constituents.
Formula:C16H21NO3Purity:Min. 95%Molecular weight:275.34 g/mol



