CAS 23520-34-5

2-hydroxy-2H-1,4-benzoxazin-3(4H)-one

Description:

2-Hydroxy-2H-1,4-benzoxazin-3(4H)-one, also known as HBX, is a chemical compound characterized by its unique bicyclic structure that includes a benzoxazine ring. This compound typically exhibits properties such as being a solid at room temperature and is often soluble in polar organic solvents. It is known for its potential applications in various fields, including agriculture, where it may act as a natural herbicide or plant growth regulator. The presence of the hydroxyl group contributes to its reactivity and ability to form hydrogen bonds, which can influence its solubility and interaction with other molecules. Additionally, 2-hydroxy-2H-1,4-benzoxazin-3(4H)-one may exhibit biological activity, including antimicrobial and antioxidant properties, making it of interest in medicinal chemistry. Its stability and reactivity can vary depending on environmental conditions, such as pH and temperature, which are important considerations in its application and handling. Overall, this compound represents a significant area of study due to its diverse potential uses and interesting chemical behavior.

Formula: C₈H₇NO₃

InChI: InChI=1/C8H7NO3/c10-7-8(11)12-6-4-2-1-3-5(6)9-7/h1-4,8,11H,(H,9,10)

SMILES: c1ccc2c(c1)N=C(C(O)O2)O

Synonyms:

• 2H-1,4-benzoxazin-3(4H)-one, 2-hydroxy-
• 2-Hydroxy-1,4-Benzoxazin-3-One
• 2-Hydroxy-2H-1,4-benzoxazin-3(4H)-one

2-Hydroxy-3,4-dihydro-2H-1,4-benzoxazin-3-one

CAS: 23520-34-5

Formula: C₈H₇NO₃

Purity: 95%

Molecular weight: 165.1461

Ref: IN-DA002NKI

2-Hydroxy-3,4-dihydro-2H-1,4-benzoxazin-3-one

CAS: 23520-34-5

2-Hydroxy-3,4-dihydro-2H-1,4-benzoxazin-3-one is a versatile compound with various applications. It is commonly used in the production of coatings and as a fatty acid leaching agent. Additionally, it is utilized in the synthesis of research chemicals such as imatinib and sildenafil citrate.

Formula: C₈H₇NO₃

Purity: Min. 95%

Molecular weight: 165.15 g/mol

Ref: 3D-YAA52034

2-Hydroxy-1,4-benzoxazin-3-one (HBOA)

Controlled Product

CAS: 23520-34-5

Formula: C₈H₇NO₃

Color and Shape: Neat

Molecular weight: 165.146

Ref: TR-H830305