CAS 23530-81-6

N-benzyl-2-methylpropan-1-amine hydrochloride (1:1)

Description:

N-benzyl-2-methylpropan-1-amine hydrochloride, with the CAS number 23530-81-6, is a chemical compound characterized by its amine functional group, which contributes to its basicity and potential reactivity. This substance is a hydrochloride salt, indicating that it is the hydrochloride form of the amine, which enhances its solubility in water and stability. The presence of the benzyl group provides aromatic characteristics, influencing its interaction with biological systems and potential applications in pharmaceuticals. Typically, compounds like this may exhibit properties such as moderate to high melting points and solubility in polar solvents due to the ionic nature of the hydrochloride. Its structure suggests potential uses in medicinal chemistry, particularly in the development of drugs targeting the central nervous system, given the amine's role in neurotransmitter activity. However, specific safety and handling guidelines should be followed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₁H₁₈ClN

InChI: InChI=1/C11H17N.ClH/c1-10(2)8-12-9-11-6-4-3-5-7-11;/h3-7,10,12H,8-9H2,1-2H3;1H

SMILES: CC(C)CNCc1ccccc1.Cl

N-benzyl-2-methylpropan-1-amine hydrochloride

CAS: 23530-81-6

Formula: C₁₁H₁₈ClN

Purity: 95.0%

Molecular weight: 199.72

Ref: 10-F359313