CAS 23537-25-9
:L-Cysteic acid monohydrate
Description:
L-Cysteic acid monohydrate is an amino acid derivative characterized by the presence of a sulfonic acid group, making it a sulfonic acid analog of cysteine. It is a white crystalline solid that is soluble in water, reflecting its polar nature due to the sulfonic acid functional group. The compound is typically used in biochemical research and studies related to protein synthesis and metabolism. L-Cysteic acid plays a role in various biological processes, including the synthesis of proteins and the regulation of cellular functions. Its monohydrate form indicates the presence of one molecule of water associated with each molecule of L-cysteic acid, which can influence its stability and solubility. The CAS number 23537-25-9 uniquely identifies this compound in chemical databases, facilitating its recognition in scientific literature and regulatory contexts. Overall, L-Cysteic acid monohydrate is significant in both research and potential therapeutic applications due to its unique chemical properties and biological relevance.
Formula:C3H7NO5S·H2O
InChI:InChI=1S/C3H7NO5S.H2O/c4-2(3(5)6)1-10(7,8)9;/h2H,1,4H2,(H,5,6)(H,7,8,9);1H2/t2-;/m0./s1
InChI key:InChIKey=PCPIXZZGBZWHJO-DKWTVANSSA-N
SMILES:[C@H](CS(=O)(=O)O)(C(O)=O)N.O
Synonyms:- (2R)-2-ammonio-3-sulfonatopropanoate
- (R)-2-Amino-3-sulfopropanoic acid hydrate
- <span class="text-smallcaps">L</span>-Alanine, 3-sulfo-, hydrate (1:1)
- <span class="text-smallcaps">L</span>-Alanine, 3-sulfo-, monohydrate
- <span class="text-smallcaps">L</span>-Cysteic acid monohydrate
- Alanine, 3-sulfo-, monohydrate, <span class="text-smallcaps">L</span>-
- L-Cysteic acid monohydrate
- Alanine, 3-sulfo-, monohydrate, L-
- L-Alanine, 3-sulfo-, monohydrate
- L-Alanine, 3-sulfo-, hydrate (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
L-Alanine, 3-sulfo-, hydrate (1:1)
CAS:Formula:C3H9NO6SPurity:97%Color and Shape:SolidMolecular weight:187.1717L-Cysteic acid monohydrate, 10mM (in DMSO)
CAS:L-Cysteic acid monohydrate, 10mM (in DMSO)Purity:≥98%Molecular weight:187.17g/molL-Cysteic acid monohydrate
CAS:L-Cysteic acid monohydrate inhibits bacterial AspT, used in surfactants, brain studies, and as an mGluRs agonist.Formula:C3H9NO6SPurity:99.82%Color and Shape:White PowderMolecular weight:187.17L-Cysteic Acid Monohydrate
CAS:Controlled ProductApplications A major metabolite of non-essential amino acid L-Cysteine.
References Parsons, R.B. et al.: Neurotoxicol., 19, 599 (1998);Formula:C3H7NO5S·H2OColor and Shape:White To Off-WhiteMolecular weight:187.17L-Cysteic acid monohydrate
CAS:L-Cysteic acid monohydrate is an amino acid derivative, which is a modified form of L-cysteine. It is formed via the oxidation of the thiol group in cysteine to a sulfonic acid group. This chemical modification influences its biochemical properties and interactions. The compound is synthesized through controlled oxidation processes in the laboratory, offering a pure form for research purposes.Formula:C3H7NO5S·H2OColor and Shape:White Off-White PowderMolecular weight:187.17 g/mol(R)-2-Amino-3-sulfopropanoic acid hydrate
CAS:Formula:C3H9NO6SPurity:97%Color and Shape:SolidMolecular weight:187.17






