CAS 23544-42-5
:(-)-Mesembranol
Description:
(-)-Mesembranol is a naturally occurring chemical compound classified as a sesquiterpene, primarily derived from the plant species of the genus Mesembryanthemum. It is characterized by its complex bicyclic structure, which contributes to its unique chemical properties and biological activities. The compound is known for its potential pharmacological effects, including anti-inflammatory and antioxidant activities, making it of interest in medicinal chemistry and natural product research. (-)-Mesembranol exhibits chirality, with its specific optical rotation being a key feature in distinguishing it from its enantiomer. Its solubility properties typically allow it to dissolve in organic solvents, while its stability can be influenced by environmental factors such as light and temperature. The compound's interactions with biological systems are an area of ongoing research, particularly in understanding its mechanisms of action and potential therapeutic applications. Overall, (-)-Mesembranol represents a significant subject of study within the field of natural products and their applications in health and medicine.
Formula:C17H25NO3
InChI:InChI=1S/C17H25NO3/c1-18-9-8-17(7-6-13(19)11-16(17)18)12-4-5-14(20-2)15(10-12)21-3/h4-5,10,13,16,19H,6-9,11H2,1-3H3/t13-,16+,17+/m1/s1
InChI key:InChIKey=KPMLOZVRLWHOBN-COXVUDFISA-N
SMILES:CN1[C@@]2([C@](CC1)(CC[C@@H](O)C2)C3=CC(OC)=C(OC)C=C3)[H]
Synonyms:- 1H-Indol-6-ol, 3a-(3,4-dimethoxyphenyl)octahydro-1-methyl-, [3aS-(3aα,6α,7aα)]-
- 1H-Indol-6-ol, 3a-(3,4-dimethoxyphenyl)octahydro-1-methyl-, (3aS,6R,7aS)-
- Mesembranol
- 4α,9α-Mesembrine, 7-deoxo-7α-hydroxy-
- (3aS,6R,7aS)-3a-(3,4-Dimethoxyphenyl)octahydro-1-methyl-1H-indol-6-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
