CymitQuimica logo

CAS 23547-02-6

:

N-(2-chloroethyl)-2-phenylacetamide

Description:
N-(2-chloroethyl)-2-phenylacetamide, with the CAS number 23547-02-6, is an organic compound characterized by its amide functional group and the presence of a chloroethyl substituent. This compound typically appears as a solid or crystalline substance and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the phenyl group contributes to its aromatic characteristics, which can influence its reactivity and interaction with biological systems. The chloroethyl moiety may impart specific properties such as increased lipophilicity, which can affect the compound's absorption and distribution in biological contexts. Additionally, the compound may exhibit various chemical behaviors, including nucleophilic substitution reactions due to the electrophilic nature of the chloroethyl group. Safety and handling considerations are essential, as the chloroethyl group can be associated with toxicity and environmental concerns. Overall, N-(2-chloroethyl)-2-phenylacetamide is a compound of interest in chemical research, particularly in the fields of drug design and synthesis.
Formula:C10H12ClNO
InChI:InChI=1/C10H12ClNO/c11-6-7-12-10(13)8-9-4-2-1-3-5-9/h1-5H,6-8H2,(H,12,13)
SMILES:c1ccc(cc1)CC(=NCCCl)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.