
CAS 23554-81-6
:(1′R,2′R,4′aS,5S,5′R,6′S,8′aS)-Decahydro-6′-hydroxy-5-(2-hydroxyethyl)-2′,5′,8′a-trimethylspiro[furan-2(3H),1′(2′H)-naphthalene]-5,5′-dimethanol
Description:
The chemical substance with the name "(1′R,2′R,4′aS,5S,5′R,6′S,8′aS)-Decahydro-6′-hydroxy-5-(2-hydroxyethyl)-2′,5′,8′a-trimethylspiro[furan-2(3H),1′(2′H)-naphthalene]-5,5′-dimethanol" and CAS number "23554-81-6" is a complex organic compound characterized by its spirocyclic structure, which includes a furan and naphthalene moiety. This compound features multiple stereocenters, indicating that it exists in specific stereoisomeric forms, which can significantly influence its chemical behavior and biological activity. The presence of hydroxyl groups suggests that it may exhibit hydrogen bonding capabilities, affecting its solubility and reactivity. Additionally, the compound's trimethyl and hydroxyethyl substituents contribute to its overall hydrophobic and hydrophilic characteristics, potentially impacting its interactions in biological systems. Such compounds are often of interest in fields like medicinal chemistry and natural product synthesis due to their structural complexity and potential pharmacological properties.
Formula:C20H36O5
InChI:InChI=1S/C20H36O5/c1-14-4-5-15-17(2,12-22)16(24)6-7-18(15,3)20(14)9-8-19(13-23,25-20)10-11-21/h14-16,21-24H,4-13H2,1-3H3/t14-,15+,16+,17+,18+,19+,20-/m1/s1
InChI key:InChIKey=XYPPDQHBNJURHU-IPOQXWOTSA-N
SMILES:C[C@@]12[C@]3(O[C@@](CCO)(CO)CC3)[C@H](C)CC[C@]1([C@@](CO)(C)[C@@H](O)CC2)[H]
Synonyms:- Lagochilin
- Spiro[furan-2(3H),1′(2′H)-naphthalene]-5,5′-dimethanol, decahydro-6′-hydroxy-5-(2-hydroxyethyl)-2′,5′,8′a-trimethyl-, (1′R,2′R,4′aS,5S,5′R,6′S,8′aS)-
- (1′R,2′R,4′aS,5S,5′R,6′S,8′aS)-Decahydro-6′-hydroxy-5-(2-hydroxyethyl)-2′,5′,8′a-trimethylspiro[furan-2(3H),1′(2′H)-naphthalene]-5,5′-dimethanol
- Spiro[furan-2(3H),1′(2′H)-naphthalene]-5,5′-dimethanol, decahydro-6′-hydroxy-5-(2-hydroxyethyl)-2′,5′,8′a-trimethyl-, [1′R-[1′α(S*),2′α,4′aα,5′α,6′β,8′aβ]]-
- Labdane-3β,15,16,18-tetrol, 9,13-epoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lagochiline
CAS:<p>Lagochiline, a diterpene compound, serves as a promising hemostatic agent and can be extracted from plants belonging to the Lagochilus species [1] [2].</p>Formula:C20H36O5Color and Shape:SolidMolecular weight:356.503
