CAS 23558-05-6
:3-O-benzyl-1,2-O-(1-methylethylidene)-alpha-D-xylo-pentodialdo-1,4-furanose
Description:
3-O-benzyl-1,2-O-(1-methylethylidene)-alpha-D-xylo-pentodialdo-1,4-furanose is a complex carbohydrate derivative characterized by its furanose ring structure, which is a five-membered cyclic form of sugars. This compound features a benzyl group at the 3-position, contributing to its hydrophobic characteristics and potential for interactions in organic synthesis. The presence of the 1,2-O-(1-methylethylidene) group indicates that it has a protective acetal structure, which can influence its reactivity and stability under various conditions. As a pentodialdo sugar, it contains two aldehyde functional groups, which are reactive sites that can participate in various chemical reactions, including oxidation and condensation. This compound may exhibit solubility in organic solvents due to its hydrophobic benzyl group, while its furanose form suggests it can participate in glycosidic bond formation. Overall, its unique structural features make it of interest in synthetic organic chemistry, particularly in the synthesis of glycosides and other carbohydrate derivatives.
Formula:C15H18O5
InChI:InChI=1/C15H18O5/c1-15(2)19-13-12(11(8-16)18-14(13)20-15)17-9-10-6-4-3-5-7-10/h3-8,11-14H,9H2,1-2H3/t11-,12+,13-,14-/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-O-Benzyl-1,2-O-isopropylidene-α-D-xylopentodialdo-1,4-furanose
CAS:<p>3-O-Benzyl-1,2-O-isopropylidene-α-D-xylopentodialdo-1,4-furanose</p>Molecular weight:278.30041g/mol3-O-Benzyl-1,2-O-isopropylidene-a-D-xylopentodialdo-1,4-furanose
CAS:<p>3-O-Benzyl-1,2-O-isopropylidene-a-D-xylopentodialdo-1,4-furanose is a synthetic sugar that can be used as a building block for the synthesis of glycoproteins, polysaccharides and other complex carbohydrates. It is also used for the modification of saccharide chains by methylation and fluorination. 3Bz DAPF was custom synthesized using high purity chemicals and has been shown to have an excellent level of purity.</p>Formula:C15H18O5·xH2OPurity:Min. 95%Color and Shape:Colourless LiquidMolecular weight:278.3


