CAS 23567-97-7

8-bromo-9-[5-O-(hydroxy{[hydroxy(phosphonooxy)phosphoryl]oxy}phosphoryl)-beta-D-ribofuranosyl]-9H-purin-2-amine

Description:

The chemical substance known as 8-bromo-9-[5-O-(hydroxy{[hydroxy(phosphonooxy)phosphoryl]oxy}phosphoryl)-beta-D-ribofuranosyl]-9H-purin-2-amine, with the CAS number 23567-97-7, is a complex nucleoside analog. It features a purine base, specifically adenine, which is substituted at the 8-position with a bromine atom, enhancing its reactivity and potential biological activity. The molecule also contains a ribofuranosyl sugar moiety, which is modified at the 5-position with a phosphonate group, indicating its potential role in biochemical pathways, particularly in nucleotide metabolism. The presence of multiple hydroxyl groups suggests that it may engage in hydrogen bonding, influencing its solubility and interaction with biological macromolecules. This compound may exhibit properties relevant to antiviral or anticancer activities, as many nucleoside analogs do, by interfering with nucleic acid synthesis. Its structural complexity and functional groups make it a subject of interest in medicinal chemistry and biochemistry for potential therapeutic applications.

Formula: C₁₀H₁₅BrN₅O₁₃P₃

InChI: InChI=1/C10H15BrN5O13P3/c11-9-14-3-1-13-10(12)15-7(3)16(9)8-6(18)5(17)4(27-8)2-26-31(22,23)29-32(24,25)28-30(19,20)21/h1,4-6,8,17-18H,2H2,(H,22,23)(H,24,25)(H2,12,13,15)(H2,19,20,21)/t4-,5-,6-,8-/m1/s1

SMILES: c1c2c(nc(=N)[nH]1)n([C@H]1[C@@H]([C@@H]([C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O1)O)O)c(Br)n2

8-Bromo-ATP

CAS: 23567-97-7

8-Bromo-ATP (8-Bromoadenosine 5'-triphosphate) is a purinergic P2X receptor agonist and an ATP analogue.

Formula: C₁₀H₁₅BrN₅O₁₃P₃

Color and Shape: Solid

Molecular weight: 586.077

Ref: TM-T39891