CAS 23571-51-9
:(5-methyl-2-nitro-1H-imidazol-1-yl)acetic acid
Description:
(5-Methyl-2-nitro-1H-imidazol-1-yl)acetic acid is a chemical compound characterized by its imidazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features a methyl group and a nitro group at specific positions on the imidazole ring, contributing to its unique reactivity and properties. The presence of the acetic acid functional group enhances its solubility in polar solvents and allows for potential interactions in biochemical systems. It is typically a solid at room temperature and may exhibit moderate stability under standard conditions. The nitro group can participate in electrophilic substitution reactions, while the carboxylic acid group can engage in hydrogen bonding and act as a proton donor. This compound may have applications in pharmaceuticals or as a biochemical probe due to its structural features. However, safety and handling precautions should be observed, as nitro compounds can be sensitive and potentially hazardous.
Formula:C6H7N3O4
InChI:InChI=1/C6H7N3O4/c1-4-2-7-6(9(12)13)8(4)3-5(10)11/h2H,3H2,1H3,(H,10,11)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
