CAS 235752-73-5

4-nitrophenyl 2-(acetylamino)-4-O-[2-(acetylamino)-2-deoxyhexopyranosyl]-2-deoxyhexopyranoside

Description:

4-Nitrophenyl 2-(acetylamino)-4-O-[2-(acetylamino)-2-deoxyhexopyranosyl]-2-deoxyhexopyranoside is a complex organic compound characterized by its glycosidic structure, which includes a nitrophenyl group and two acetylamino substituents. This compound features a hexopyranoside backbone, indicating that it is derived from a six-membered sugar ring, specifically a deoxy sugar, which suggests modifications that enhance its biological activity or solubility. The presence of the nitro group typically imparts unique electronic properties, potentially influencing its reactivity and interactions in biological systems. The acetylamino groups suggest that the compound may participate in hydrogen bonding, which can affect its solubility and stability. This compound may be of interest in medicinal chemistry or biochemistry due to its structural complexity and potential applications in drug development or as a biochemical probe. Its CAS number, 235752-73-5, allows for precise identification in chemical databases and literature. Overall, this compound exemplifies the intricate relationship between structure and function in organic chemistry.

Formula: C₂₂H₃₁N₃O₁₃

InChI: InChI=1/C22H31N3O13/c1-9(28)23-15-18(31)17(30)13(7-26)36-22(15)38-20-14(8-27)37-21(16(19(20)32)24-10(2)29)35-12-5-3-11(4-6-12)25(33)34/h3-6,13-22,26-27,30-32H,7-8H2,1-2H3,(H,23,28)(H,24,29)

SMILES: CC(=NC1C(C(C(CO)OC1OC1C(CO)OC(C(C1O)N=C(C)O)Oc1ccc(cc1)N(=O)=O)O)O)O

α-D-Galactopyranoside, 4-nitrophenyl 2-(acetylamino)-6-O-[2-(acetylamino)-2-deoxy-β-D-glucopyranosyl]-2-deoxy-

CAS: 235752-73-5

Formula: C₂₂H₃₁N₃O₁₃

Color and Shape: Solid

Molecular weight: 545.4938

Ref: IN-DA002NQ5

4-Nitrophenyl 2-acetamido-6-O-(2-acetamido-2-deoxy-b-D-glucopyranosyl)-2-deoxy-a-D-galactopyranoside

CAS: 235752-73-5

Ref: 7W-GC9012

4-Nitrophenyl 2-acetamido-6-O-(2-acetamido-2-deoxy-b-D-glucopyranosyl)-2-deoxy-a-D-galactopyranoside

CAS: 235752-73-5

4-Nitrophenyl 2-acetamido-6-O-(2-acetamido-2-deoxy-b-D-glucopyranosyl)-2-deoxy-a-D-galactopyranoside is a chromogenic pNP glycoside substrate designed for the detection and assay of specific enzymes, particularly glycosidases. Upon enzymatic hydrolysis, this substrate releases a quantifiable 4-nitrophenol moiety enabling straightforward colorimetric measurement. This pNP-linked substrate is versatile and can be efficiently employed in enzyme activity assays, screening enzyme inhibitors, and assessing enzyme mechanisms, enhancing research and development processes in the field of glycobiology.

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 545.49 g/mol

Ref: 3D-EN06448