CAS 235752-73-5
:4-nitrophenyl 2-(acetylamino)-4-O-[2-(acetylamino)-2-deoxyhexopyranosyl]-2-deoxyhexopyranoside
Description:
4-Nitrophenyl 2-(acetylamino)-4-O-[2-(acetylamino)-2-deoxyhexopyranosyl]-2-deoxyhexopyranoside is a complex organic compound characterized by its glycosidic structure, which includes a nitrophenyl group and two acetylamino substituents. This compound features a hexopyranoside backbone, indicating that it is derived from a six-membered sugar ring, specifically a deoxy sugar, which suggests modifications that enhance its biological activity or solubility. The presence of the nitro group typically imparts unique electronic properties, potentially influencing its reactivity and interactions in biological systems. The acetylamino groups suggest that the compound may participate in hydrogen bonding, which can affect its solubility and stability. This compound may be of interest in medicinal chemistry or biochemistry due to its structural complexity and potential applications in drug development or as a biochemical probe. Its CAS number, 235752-73-5, allows for precise identification in chemical databases and literature. Overall, this compound exemplifies the intricate relationship between structure and function in organic chemistry.
Formula:C22H31N3O13
InChI:InChI=1/C22H31N3O13/c1-9(28)23-15-18(31)17(30)13(7-26)36-22(15)38-20-14(8-27)37-21(16(19(20)32)24-10(2)29)35-12-5-3-11(4-6-12)25(33)34/h3-6,13-22,26-27,30-32H,7-8H2,1-2H3,(H,23,28)(H,24,29)
SMILES:CC(=NC1C(C(C(CO)OC1OC1C(CO)OC(C(C1O)N=C(C)O)Oc1ccc(cc1)N(=O)=O)O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
α-D-Galactopyranoside, 4-nitrophenyl 2-(acetylamino)-6-O-[2-(acetylamino)-2-deoxy-β-D-glucopyranosyl]-2-deoxy-
CAS:Formula:C22H31N3O13Color and Shape:SolidMolecular weight:545.49384-Nitrophenyl 2-acetamido-6-O-(2-acetamido-2-deoxy-b-D-glucopyranosyl)-2-deoxy-a-D-galactopyranoside
CAS:4-Nitrophenyl 2-acetamido-6-O-(2-acetamido-2-deoxy-b-D-glucopyranosyl)-2-deoxy-a-D-galactopyranoside is a chromogenic pNP glycoside substrate designed for the detection and assay of specific enzymes, particularly glycosidases. Upon enzymatic hydrolysis, this substrate releases a quantifiable 4-nitrophenol moiety enabling straightforward colorimetric measurement. This pNP-linked substrate is versatile and can be efficiently employed in enzyme activity assays, screening enzyme inhibitors, and assessing enzyme mechanisms, enhancing research and development processes in the field of glycobiology.Purity:Min. 95%Color and Shape:White PowderMolecular weight:545.49 g/mol


