CAS 23576-91-2

5,6-Dichloroimidazo[2,1-b]thiazole

Description:

5,6-Dichloroimidazo[2,1-b]thiazole is a heterocyclic compound characterized by its fused imidazole and thiazole rings, which incorporate two chlorine substituents at the 5 and 6 positions. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its biological activity, particularly in the field of medicinal chemistry, where it has been investigated for its potential as an antimicrobial and antifungal agent. The presence of chlorine atoms enhances its reactivity and can influence its interaction with biological targets. The compound is soluble in organic solvents but may have limited solubility in water, which is a common characteristic of many heterocyclic compounds. Its molecular structure contributes to its unique chemical properties, making it a subject of interest in various research applications, including drug development and material science. Safety data should be consulted for handling and usage, as halogenated compounds can pose environmental and health risks.

Formula: C₅H₂Cl₂N₂S

InChI: InChI=1S/C5H2Cl2N2S/c6-3-4(7)9-1-2-10-5(9)8-3/h1-2H

InChI key: InChIKey=URPPMRGEGZBMHO-UHFFFAOYSA-N

SMILES: ClC=1N2C(=NC1Cl)SC=C2

Synonyms:

• 5,6-Dichloroimidazo[2,1-b]thiazole
• Imidazo[2,1-b]thiazole, 5,6-dichloro-

5,6-Dichloroimidazo[2,1-b][1,3]thiazole

CAS: 23576-91-2

Versatile small molecule scaffold

Formula: C₅H₂Cl₂N₂S

Purity: Min. 95%

Molecular weight: 193.05 g/mol

Ref: 3D-YAA57691