CAS 2358-22-7

2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide

Description:

2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide is a perfluorinated compound characterized by a long carbon chain with multiple fluorine substituents. This compound features a heptanamide structure, indicating the presence of an amide functional group (-C(=O)N-) at one end of the carbon chain. The extensive fluorination imparts unique properties, such as high thermal stability, low surface tension, and resistance to chemical degradation, making it useful in various applications, including surfactants and coatings. Its high electronegativity contributes to a low reactivity profile, while the presence of the amide group can enhance solubility in polar solvents. Additionally, the compound is likely to exhibit low volatility and high hydrophobicity due to the fluorinated carbon chain. However, environmental and health considerations are important, as perfluorinated compounds can persist in the environment and may have bioaccumulation potential. Overall, 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptanamide is notable for its unique chemical properties and potential applications, alongside concerns regarding its environmental impact.

Formula: C₇H₂F₁₃NO

InChI: InChI=1/C7H2F13NO/c8-2(9,1(21)22)3(10,11)4(12,13)5(14,15)6(16,17)7(18,19)20/h(H2,21,22)

SMILES: C(=N)(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O

Synonyms:

• Heptanamide, 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-
• 2,2,3,3,4,4,5,5,6,6,7,7,7-Tridecafluoroheptanamide

Heptanamide, 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-

CAS: 2358-22-7

Formula: C₇H₂F₁₃NO

Purity: 97%

Color and Shape: Solid

Molecular weight: 363.0761

Ref: IN-DA002NRA

Perfluoroheptanamide

CAS: 2358-22-7

Perfluoroheptanamide

Purity: ≥95%

Molecular weight: 363.08g/mol

Ref: 54-PC6768

2,2,3,3,4,4,5,5,6,6,7,7,7-Tridecafluoroheptanamide

CAS: 2358-22-7

2,2,3,3,4,4,5,5,6,6,7,7,7-Tridecafluoroheptanamide is a fluorinated surfactant. It can be synthesized from the reaction of an alkali metal with an alkyl chloride and a benzyl alcohol. 2-Fluoroethanol can also be used for synthesis. This agent is a monomer containing a hydroxyl group and a carboxylic acid group that has the ability to form amphoteric surfactants. It is used in coatings as it has good surface properties and provides hydrophobic and oleophobic properties. 2-Fluoroethanol is also used in the production of surfactants such as alkyl sulfates or alkyl sulfonates.

Formula: C₇H₂F₁₃NO

Purity: Min. 95%

Molecular weight: 363.08 g/mol

Ref: 3D-FT91899