CAS 23586-96-1

(5-fluoro-3-pyridyl)methanamine

Description:

(5-Fluoro-3-pyridyl)methanamine is an organic compound characterized by the presence of a pyridine ring substituted with a fluorine atom and an amine group. The molecular structure features a five-membered aromatic ring, which contributes to its stability and reactivity. The fluorine atom, being electronegative, influences the compound's electronic properties, potentially enhancing its reactivity in nucleophilic substitution reactions. The amine group (-NH2) is a functional group that can participate in hydrogen bonding, making the compound soluble in polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other functional groups. As with many organic compounds, safety precautions should be taken when handling (5-fluoro-3-pyridyl)methanamine, as it may pose health risks if ingested or inhaled. Overall, this compound's unique structure and functional groups make it a subject of interest in various chemical research fields.

Formula: C₆H₇FN₂

InChI: InChI=1/C6H7FN2/c7-6-1-5(2-8)3-9-4-6/h1,3-4H,2,8H2

SMILES: c1c(CN)cncc1F

Synonyms:

• (5-Fluoropyridin-3-Yl)Methanamine
• 1-(5-Fluoropyridin-3-yl)methanamine
• 3-Pyridinemethanamine, 5-fluoro-

3-Pyridinemethanamine, 5-fluoro-

CAS: 23586-96-1

Formula: C₆H₇FN₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 126.1316

Ref: IN-DA002NSE

3-(Aminomethyl)-5-fluoropyridine

CAS: 23586-96-1

3-(Aminomethyl)-5-fluoropyridine

Purity: 97%

Molecular weight: 126.13g/mol

Ref: 54-PC11100

3-Aminomethyl-5-fluoropyridine

CAS: 23586-96-1

Formula: C₆H₇FN₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 126.134

Ref: 10-F214790

(5-Fluoropyridin-3-yl)methylamine

CAS: 23586-96-1

Versatile small molecule scaffold

Formula: C₆H₇FN₂

Purity: Min. 95%

Molecular weight: 126.13 g/mol

Ref: 3D-YAA58696