CymitQuimica logo

CAS 23589-03-9

:

3-[5-(4-fluorophenyl)furan-2-yl]propanoic acid

Description:
3-[5-(4-Fluorophenyl)furan-2-yl]propanoic acid, with the CAS number 23589-03-9, is an organic compound characterized by its unique structure that includes a furan ring and a propanoic acid moiety. The presence of the 4-fluorophenyl group enhances its chemical properties, potentially influencing its reactivity and biological activity. This compound is likely to exhibit moderate solubility in organic solvents due to its aromatic and polar functional groups. It may participate in various chemical reactions, including esterification and amidation, owing to the carboxylic acid functional group. Additionally, the fluorine atom can impart specific electronic properties, which may affect its interaction with biological targets, making it of interest in medicinal chemistry. The compound's potential applications could span pharmaceuticals, agrochemicals, or materials science, depending on its biological activity and stability. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the fluorine atom, which can influence toxicity and environmental impact.
Formula:C13H11FO3
InChI:InChI=1/C13H11FO3/c14-10-3-1-9(2-4-10)12-7-5-11(17-12)6-8-13(15)16/h1-5,7H,6,8H2,(H,15,16)
SMILES:c1cc(ccc1c1ccc(CCC(=O)O)o1)F
Synonyms:
  • 2-Furanpropanoic acid, 5-(4-fluorophenyl)-
  • 3-[5-(4-Fluorophenyl)-2-furyl]propanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.