CymitQuimica logo

CAS 23589-06-2

:

3-[5-(4-methylphenyl)furan-2-yl]propanoic acid

Description:
3-[5-(4-Methylphenyl)furan-2-yl]propanoic acid, with the CAS number 23589-06-2, is an organic compound characterized by its unique structure that includes a furan ring and a propanoic acid moiety. This compound features a furan ring substituted with a 4-methylphenyl group, which contributes to its aromatic properties and potential biological activity. The presence of the propanoic acid functional group indicates that it can exhibit acidic behavior, making it soluble in polar solvents. The compound's molecular structure suggests potential applications in pharmaceuticals or as a building block in organic synthesis, particularly in the development of biologically active molecules. Its specific interactions and reactivity can be influenced by the substituents on the furan and phenyl rings, which may affect its stability, solubility, and overall chemical behavior. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, due to potential toxicity or reactivity.
Formula:C14H14O3
InChI:InChI=1/C14H14O3/c1-10-2-4-11(5-3-10)13-8-6-12(17-13)7-9-14(15)16/h2-6,8H,7,9H2,1H3,(H,15,16)
InChI key:XIEFXNUAGJCARS-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1)c1ccc(CCC(=O)O)o1
Synonyms:
  • 2-Furanpropanoic acid, 5-(4-methylphenyl)-
  • 3-[5-(4-Methylphenyl)-2-furyl]propanoic acid
Found 1 products.