CAS 2359-09-3
:5-tert-Butylisophthalic acid
Description:
5-tert-Butylisophthalic acid is an aromatic dicarboxylic acid characterized by its two carboxylic acid functional groups (-COOH) attached to an isophthalic acid framework, with a tert-butyl group positioned at the 5th carbon of the aromatic ring. This compound is typically a white to off-white solid at room temperature and is known for its relatively high melting point. It is soluble in organic solvents such as acetone and ethanol but has limited solubility in water. The presence of the bulky tert-butyl group enhances its steric hindrance, which can influence its reactivity and interactions with other molecules. 5-tert-Butylisophthalic acid is often utilized in the synthesis of polyesters and other polymers, contributing to materials with improved thermal and mechanical properties. Additionally, it can serve as a building block in the production of various chemical intermediates and specialty chemicals. Its applications extend to coatings, adhesives, and other industrial materials, where its unique structural features can enhance performance characteristics.
Formula:C12H14O4
InChI:InChI=1S/C12H14O4/c1-12(2,3)9-5-7(10(13)14)4-8(6-9)11(15)16/h4-6H,1-3H3,(H,13,14)(H,15,16)
InChI key:InChIKey=BJLUCDZIWWSFIB-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C1=CC(C(O)=O)=CC(C(O)=O)=C1
Synonyms:- 1,3-Benzenedicarboxylic acid, 5-(1,1-dimethylethyl)-
- 5-(1,1-Dimethylethyl)-1,3-benzenedicarboxylic acid
- 5-Tert-Butylbenzene-1,3-Dicarboxylic Acid
- 5-tert-Butyl-1,3-benzenedicarboxylic acid
- 5-tert-Butyl-m-phthalic acid
- Isophthalic acid, 5-tert-butyl-
- 5-tert-Butylisophthalic acid
- 5-tert-Butylisophthalic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-tert-Butylisophthalic Acid
CAS:Formula:C12H14O4Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:222.241,3-Benzenedicarboxylic acid, 5-(1,1-dimethylethyl)-
CAS:Formula:C12H14O4Purity:96%Color and Shape:SolidMolecular weight:222.23725-tert-Butyl-isophthalic acid
CAS:5-tert-Butyl-isophthalic acid is a chemical compound that is used in the production of various chemicals and pharmaceuticals. It is a versatile building block, a useful intermediate, and a reagent for producing other compounds. 5-tert-Butyl-isophthalic acid has been found to be useful as a starting material or reaction component in the synthesis of many different compounds, such as amino acids, peptides, vitamins, hormones, drugs and dyes. 5-tert-Butyl-isophthalic acid is also used to produce complex compounds with high purity. This chemical is listed by CAS number 2359-09-3 and can be purchased from Sigma Aldrich.br> br>br>Formula:C12H14O4Purity:Min. 95%Color and Shape:PowderMolecular weight:222.24 g/mol5-(tert-Butyl)isophthalic acid
CAS:Formula:C12H14O4Purity:95%Color and Shape:SolidMolecular weight:222.24




