CymitQuimica logo

CAS 23595-00-8

:

2-{nitroso[3-(trifluoromethyl)phenyl]amino}benzoic acid

Description:
2-{Nitroso[3-(trifluoromethyl)phenyl]amino}benzoic acid, with CAS number 23595-00-8, is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety and a nitroso group attached to an amino group. This compound features a trifluoromethyl group, which significantly influences its chemical properties, including increased lipophilicity and potential reactivity. The presence of the nitroso group suggests that it may participate in various chemical reactions, such as reduction or coupling reactions, making it of interest in synthetic organic chemistry. Additionally, the trifluoromethyl group can enhance the compound's biological activity and stability. The compound may exhibit unique optical and electronic properties due to its aromatic structure and substituents. As with many nitroso compounds, it is essential to handle this substance with care, as it may pose health risks, including potential toxicity. Overall, 2-{Nitroso[3-(trifluoromethyl)phenyl]amino}benzoic acid is a noteworthy compound for research in both chemical synthesis and potential applications in pharmaceuticals or materials science.
Formula:C14H9F3N2O3
InChI:InChI=1/C14H9F3N2O3/c15-14(16,17)9-4-3-5-10(8-9)19(18-22)12-7-2-1-6-11(12)13(20)21/h1-8H,(H,20,21)
SMILES:c1ccc(c(c1)C(=O)O)N(c1cccc(c1)C(F)(F)F)N=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.