CAS 23596-25-0

6-chloro-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine

Description:

6-Chloro-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 6-position introduces both electronegativity and steric effects, influencing the compound's reactivity and potential applications. This compound typically exhibits moderate solubility in organic solvents, reflecting its non-polar characteristics due to the aromatic nature of the pyridine ring. It may participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions, depending on the reaction conditions. The compound's structure suggests potential biological activity, making it of interest in medicinal chemistry for the development of pharmaceuticals. Additionally, its unique framework may allow for the synthesis of derivatives with varied functional groups, enhancing its versatility in research and application. Overall, 6-chloro-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine is a valuable compound in the field of organic chemistry and drug discovery.

Formula: C₇H₇ClN₂

InChI: InChI=1/C7H7ClN2/c8-7-3-6-5(4-10-7)1-2-9-6/h3-4,9H,1-2H2

SMILES: C1CNc2cc(Cl)ncc12

1H-Pyrrolo[3,2-c]pyridine, 6-chloro-2,3-dihydro-

CAS: 23596-25-0

Formula: C₇H₇ClN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 154.5969

Ref: IN-DA002NTN

6-Chloro-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine

CAS: 23596-25-0

6-Chloro-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine

Purity: 97%

Molecular weight: 154.6g/mol

Ref: 54-OR1035145

6-Chloro-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine

CAS: 23596-25-0

Formula: C₇H₇ClN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 154.6

Ref: 10-F231190

6-Chloro-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine

Controlled Product

CAS: 23596-25-0

Formula: C₇H₇ClN₂

Color and Shape: Neat

Molecular weight: 154.597

Ref: TR-C277800

6-Chloro-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine

CAS: 23596-25-0

6-Chloro-2,3-dihydro-1H-pyrrolo[3,2-c]pyridine is a chemical compound which has been used as an intermediate in the synthesis of other compounds. It is a condensation product of 2,4,6-trichloropyrimidine with azaindole. The condensation reaction was carried out in DMF at 100°C for 18 hours. This product is a yellow solid with mp of 164°C.

Formula: C₇H₇ClN₂

Purity: Min. 95%

Molecular weight: 154.6 g/mol

Ref: 3D-FC143744