CAS 23596-28-3
:2,3-Dihydro-1H-pyrrolo[3,2-c]pyridine
Description:
2,3-Dihydro-1H-pyrrolo[3,2-c]pyridine is a bicyclic organic compound characterized by its unique fused ring structure, which consists of a pyridine and a pyrrole moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of nitrogen atoms in its structure contributes to its basicity and potential reactivity, allowing it to participate in various chemical reactions, such as electrophilic substitutions. Additionally, 2,3-Dihydro-1H-pyrrolo[3,2-c]pyridine may exhibit interesting pharmacological properties, including neuroprotective and anti-inflammatory effects, which have been explored in various studies. Its solubility in organic solvents and limited solubility in water are typical for compounds of this class, influencing its application in synthesis and biological assays. Overall, this compound represents a significant area of research due to its structural features and potential therapeutic applications.
Formula:C7H8N2
InChI:InChI=1S/C7H8N2/c1-4-9-7-2-3-8-5-6(1)7/h2-3,5,9H,1,4H2
InChI key:InChIKey=UPZFJNRJKUKWGW-UHFFFAOYSA-N
SMILES:C1=2C(NCC1)=CC=NC2
Synonyms:- 1H,2H,3H-Pyrrolo[3,2-c]pyridine
- 1H-Pyrrolo[3,2-c]pyridine, 2,3-dihydro-
- 2,3-Dihydro-5-azaindole
- 5-Azaindoline
- 2,3-Dihydro-1H-pyrrolo[3,2-c]pyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Pyrrolo[3,2-c]pyridine, 2,3-dihydro-
CAS:Formula:C7H8N2Purity:97%Color and Shape:SolidMolecular weight:120.15182,3-Dihydro-1H-pyrrolo[3,2-c]pyridine
CAS:2,3-Dihydro-1H-pyrrolo[3,2-c]pyridinePurity:97%Color and Shape:SolidMolecular weight:120.15g/mol2,3-DIHYDRO-1H-PYRROLO[3,2-C]PYRIDINE
CAS:Formula:C7H8N2Purity:95%Color and Shape:SolidMolecular weight:120.1552,3-Dihydro-1H-pyrrolo[3,2-c]pyridine
CAS:2,3-Dihydro-1H-pyrrolo[3,2-c]pyridine is an alkaloid compound that has various applications in research and chemical studies. It has been found to interact with dopamine receptors and exhibit photothermal properties. This compound has been studied in the context of G. lucidum (also known as Reishi mushroom) and its potential therapeutic effects. Additionally, it has shown interactions with quinpirole, lithium, ergovaline, efrotomycin, and other compounds. The photocatalytic and fatty acid properties of 2,3-Dihydro-1H-pyrrolo[3,2-c]pyridine make it a versatile compound for various research purposes.
Purity:Min. 95%



