CymitQuimica logo

CAS 23597-15-1

:

2-Amino-3,5-diiodopyridine

Description:
2-Amino-3,5-diiodopyridine is an organic compound characterized by the presence of an amino group and two iodine substituents on a pyridine ring. The molecular structure features a six-membered aromatic ring containing one nitrogen atom, which contributes to its basicity and potential reactivity. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. It is soluble in polar solvents, such as water and alcohols, due to the amino group, which can engage in hydrogen bonding. The presence of iodine atoms enhances its reactivity, making it useful in various chemical syntheses, including the development of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry. Safety precautions should be taken when handling this substance, as iodine-containing compounds can be hazardous. Overall, 2-Amino-3,5-diiodopyridine is a versatile compound with applications in both research and industry.
Formula:C5H4I2N2
InChI:InChI=1/C5H4I2N2/c6-3-1-4(7)5(8)9-2-3/h1-2H,(H2,8,9)
InChI key:QLJWHQFRDOOATP-UHFFFAOYSA-N
SMILES:c1c(cnc(c1I)N)I
Synonyms:
  • 2-Pyridinamine, 3,5-Diiodo-
  • 3,5-Diiodopyridin-2-amine
Found 4 products.