CAS 23599-45-3

(-)-Cinnamodial

Description:

(-)-Cinnamodial, with the CAS number 23599-45-3, is a naturally occurring compound primarily derived from the essential oils of certain plants, particularly those in the Cinnamomum genus. It is characterized by its distinctive aromatic properties, often associated with a sweet, spicy scent reminiscent of cinnamon. Chemically, (-)-Cinnamodial is classified as a phenylpropanoid, featuring a structure that includes a phenolic ring and an aldehyde functional group. This compound exhibits various biological activities, including antimicrobial, anti-inflammatory, and potential anticancer properties, making it of interest in both pharmacological and cosmetic applications. Its stereochemistry, indicated by the prefix "(-)", denotes its specific optical activity, which can influence its interactions in biological systems. Additionally, (-)-Cinnamodial is soluble in organic solvents, which facilitates its extraction and use in formulations. Overall, its unique chemical structure and biological activities contribute to its significance in natural product chemistry and potential therapeutic applications.

Formula: C₁₇H₂₄O₅

InChI: InChI=1S/C17H24O5/c1-11(20)22-13-8-12(9-18)17(21,10-19)16(4)7-5-6-15(2,3)14(13)16/h8-10,13-14,21H,5-7H2,1-4H3/t13-,14+,16+,17-/m1/s1

InChI key: InChIKey=UKLMEFSRPRDOLD-YQFWSFKMSA-N

SMILES: C[C@]12[C@@]([C@H](OC(C)=O)C=C(C=O)[C@@]1(C=O)O)(C(C)(C)CCC2)[H]

Synonyms:

• (-)-Cinnamodial
• (-)-Ugandensidial
• (1S,4R,4aS,8aS)-4-(Acetyloxy)-1,4,4a,5,6,7,8,8a-octahydro-1-hydroxy-5,5,8a-trimethyl-1,2-naphthalenedicarboxaldehyde
• 1,2-Naphthalenedicarboxaldehyde, 1,4,4a,5,6,7,8,8a-octahydro-1,4-dihydroxy-5,5,8a-trimethyl-, 4-acetate, (1S,4R,4aS,8aS)-(-)-
• 1,2-Naphthalenedicarboxaldehyde, 4-(acetyloxy)-1,4,4a,5,6,7,8,8a-octahydro-1-hydroxy-5,5,8a-trimethyl-, [1S-(1α,4β,4aα,8aβ)]-
• 1,2-naphthalenedicarboxaldehyde, 4-(acetyloxy)-1,4,4a,5,6,7,8,8a-octahydro-1-hydroxy-5,5,8a-trimethyl-, (1S,4R,4aS,8aS)-
• Agandencidial

Cinnamodial

CAS: 23599-45-3

Cinnamodial is a naturally occurring compound classified as a sesquiterpene dialdehyde, which is isolated from cinnamon oil, derived primarily from the bark of the Cinnamomum tree. Its primary mode of action involves disrupting cellular integrity through binding with fungal cell membranes, leading to increased permeability and ultimately cell death. This mechanism highlights its potential as an effective antifungal agent.

Formula: C₁₇H₂₄O₅

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 308.37 g/mol

Ref: 3D-FC137830